EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6N2O4 |
| Net Charge | 0 |
| Average Mass | 134.091 |
| Monoisotopic Mass | 134.03276 |
| SMILES | NC(=O)N[C@@H](O)C(=O)O |
| InChI | InChI=1S/C3H6N2O4/c4-3(9)5-1(6)2(7)8/h1,6H,(H,7,8)(H3,4,5,9)/t1-/m0/s1 |
| InChIKey | NWZYYCVIOKVTII-SFOWXEAESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-ureidoglycolic acid (CHEBI:15412) has role Escherichia coli metabolite (CHEBI:76971) |
| (−)-ureidoglycolic acid (CHEBI:15412) has role mouse metabolite (CHEBI:75771) |
| (−)-ureidoglycolic acid (CHEBI:15412) is a ureidoglycolic acid (CHEBI:49050) |
| (−)-ureidoglycolic acid (CHEBI:15412) is conjugate acid of (−)-ureidoglycolate (CHEBI:57296) |
| (−)-ureidoglycolic acid (CHEBI:15412) is enantiomer of (+)-ureidoglycolic acid (CHEBI:28785) |
| Incoming Relation(s) |
| (−)-ureidoglycolate (CHEBI:57296) is conjugate base of (−)-ureidoglycolic acid (CHEBI:15412) |
| (+)-ureidoglycolic acid (CHEBI:28785) is enantiomer of (−)-ureidoglycolic acid (CHEBI:15412) |
| IUPAC Name |
|---|
| (2S)-(carbamoylamino)(hydroxy)acetic acid |
| Synonyms | Source |
|---|---|
| (S)-Ureidoglycolate | KEGG COMPOUND |
| (-)-Ureidoglycolate | KEGG COMPOUND |