EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O2 |
| Net Charge | 0 |
| Average Mass | 88.106 |
| Monoisotopic Mass | 88.05243 |
| SMILES | CC(=O)[C@@H](C)O |
| InChI | InChI=1S/C4H8O2/c1-3(5)4(2)6/h3,5H,1-2H3/t3-/m1/s1 |
| InChIKey | ROWKJAVDOGWPAT-GSVOUGTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-acetoin (CHEBI:15686) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| (R)-acetoin (CHEBI:15686) is a acetoin (CHEBI:15688) |
| IUPAC Name |
|---|
| (3R)-3-hydroxybutan-2-one |
| Synonyms | Source |
|---|---|
| (R)-2-acetoin | ChEBI |
| (R)-2-Acetoin | KEGG COMPOUND |
| (R)-3-hydroxy-2-butanone | ChEBI |
| (R)-3-Hydroxy-2-butanone | KEGG COMPOUND |
| (R)-3-hydroxybutan-2-one | ChEBI |
| (R)-3-Hydroxybutan-2-one | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (R)-acetoin | UniProt |