EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42N7O20P3S |
| Net Charge | 0 |
| Average Mass | 897.640 |
| Monoisotopic Mass | 897.14182 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)C[C@](C)(O)C(=O)O |
| InChI | InChI=1S/C26H42N7O20P3S/c1-25(2,19(37)22(38)29-5-4-14(34)28-6-7-57-15(35)8-26(3,41)24(39)40)10-50-56(47,48)53-55(45,46)49-9-13-18(52-54(42,43)44)17(36)23(51-13)33-12-32-16-20(27)30-11-31-21(16)33/h11-13,17-19,23,36-37,41H,4-10H2,1-3H3,(H,28,34)(H,29,38)(H,39,40)(H,45,46)(H,47,48)(H2,27,30,31)(H2,42,43,44)/t13-,17-,18-,19+,23-,26+/m1/s1 |
| InChIKey | XYGOWHUIVNMEIA-XBVYHAPZSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-citramalyl-CoA (CHEBI:36882) has functional parent L-citramalic acid (CHEBI:29003) |
| (3S)-citramalyl-CoA (CHEBI:36882) is a citramalyl-CoA (CHEBI:15457) |
| (3S)-citramalyl-CoA (CHEBI:36882) is conjugate acid of (3S)-citramalyl-CoA(5−) (CHEBI:58668) |
| Incoming Relation(s) |
| (3S)-citramalyl-CoA(5−) (CHEBI:58668) is conjugate base of (3S)-citramalyl-CoA (CHEBI:36882) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-({3-[(2-{[(3S)-3-carboxy-3-hydroxybutanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| (3S)-Citramalyl-CoA | KEGG COMPOUND |
| L-Citramalyl-CoA | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01011 | KEGG COMPOUND |
| CPD-627 | MetaCyc |
| HMDB0006345 | HMDB |