EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | [H][C@@]1(C(=C)C)CC=C(C)CC1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m1/s1 |
| InChIKey | XMGQYMWWDOXHJM-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4S)-limonene (CHEBI:15383) is a limonene (CHEBI:15384) |
| (4S)-limonene (CHEBI:15383) is enantiomer of (4R)-limonene (CHEBI:15382) |
| Incoming Relation(s) |
| (4S)-4-isopropenyl-1-methyl-2-methylene-7-oxabicyclo[4.1.0]heptane (CHEBI:59103) has parent hydride (4S)-limonene (CHEBI:15383) |
| (7R)-7-isopropenyl-4-methyl-1-oxaspiro[2.5]oct-4-ene (CHEBI:59102) has parent hydride (4S)-limonene (CHEBI:15383) |
| (4R)-limonene (CHEBI:15382) is enantiomer of (4S)-limonene (CHEBI:15383) |
| IUPAC Name |
|---|
| (4S)-1-methyl-4-(prop-1-en-2-yl)cyclohex-1-ene |
| Synonyms | Source |
|---|---|
| (4S)-1-methyl-4-isopropenylcyclohex-1-ene | IUBMB |
| (4S)-4-isopropenyl-1-methylcyclohexene | ChEBI |
| (-)-(4S)-Limonene | KEGG COMPOUND |
| 4αH-p-mentha-1,8-diene | IUPAC |
| (S)-1-methyl-4-(1-methylethenyl)cyclohexene | ChemIDplus |
| (S)-(−)-p-mentha-1,8-diene | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (4S)-limonene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000803 | KNApSAcK |
| C00521 | KEGG COMPOUND |
| LMPR0102090002 | LIPID MAPS |