EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | CC(C)c1ccc(CO)cc1 |
| InChI | InChI=1S/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | OIGWAXDAPKFNCQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chamaecyparis lawsoniana (ncbitaxon:58030) | |||
| stem (BTO:0001300) | PubMed (23157017) | Isolated from the stem essential oil | |
| leaf (BTO:0000713) | PubMed (23157017) | Isolated from the leaf essential oil | |
| Cuminum cyminum (ncbitaxon:52462) | seed (BTO:0001226) | PubMed (23507295) | |
| Zanthoxylum armatum (ncbitaxon:67938) | seed (BTO:0001226) | PubMed (20628994) | |
| Zanthoxylum piperitum (ncbitaxon:354529) | pericarp (BTO:0001017) | PubMed (20628994) |
| Roles Classification |
|---|
| Biological Roles: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | insect repellent An insecticide that acts as a repellent to insects. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-isopropylbenzyl alcohol (CHEBI:27628) has functional parent p-cymene (CHEBI:28768) |
| 4-isopropylbenzyl alcohol (CHEBI:27628) has role fragrance (CHEBI:48318) |
| 4-isopropylbenzyl alcohol (CHEBI:27628) has role insect repellent (CHEBI:71692) |
| 4-isopropylbenzyl alcohol (CHEBI:27628) has role plant metabolite (CHEBI:76924) |
| 4-isopropylbenzyl alcohol (CHEBI:27628) has role volatile oil component (CHEBI:27311) |
| 4-isopropylbenzyl alcohol (CHEBI:27628) has role xenobiotic metabolite (CHEBI:76206) |
| 4-isopropylbenzyl alcohol (CHEBI:27628) is a p-menthane monoterpenoid (CHEBI:25186) |
| 4-isopropylbenzyl alcohol (CHEBI:27628) is a benzyl alcohols (CHEBI:22743) |
| IUPAC Name |
|---|
| [4-(propan-2-yl)phenyl]methanol |
| Synonyms | Source |
|---|---|
| 4-(1-Methylethyl)benzenemethanol | ChemIDplus |
| (4-isopropylphenyl)methanol | ChEBI |
| (4-propan-2-ylphenyl)methanol | ChEBI |
| Cumic alcohol | ChemIDplus |
| Cumin alcohol | NIST Chemistry WebBook |
| Cuminic alcohol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 4-isopropylbenzyl alcohol | UniProt |
| Citations |
|---|