EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N4O13P3 |
| Net Charge | 0 |
| Average Mass | 492.167 |
| Monoisotopic Mass | 491.98485 |
| SMILES | O=c1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C10H15N4O13P3/c15-5-1-7(14-4-13-8-9(14)11-3-12-10(8)16)25-6(5)2-24-29(20,21)27-30(22,23)26-28(17,18)19/h3-7,15H,1-2H2,(H,20,21)(H,22,23)(H,11,12,16)(H2,17,18,19)/t5-,6+,7+/m0/s1 |
| InChIKey | UFJPAQSLHAGEBL-RRKCRQDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dITP (CHEBI:28807) has role Escherichia coli metabolite (CHEBI:76971) |
| dITP (CHEBI:28807) has role mouse metabolite (CHEBI:75771) |
| dITP (CHEBI:28807) is a deoxyinosine phosphate (CHEBI:23630) |
| dITP (CHEBI:28807) is a purine 2'-deoxyribonucleoside 5'-triphosphate (CHEBI:37042) |
| dITP (CHEBI:28807) is conjugate acid of dITP(4−) (CHEBI:61382) |
| Incoming Relation(s) |
| dITP(4−) (CHEBI:61382) is conjugate base of dITP (CHEBI:28807) |
| IUPAC Name |
|---|
| 2'-deoxyinosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| 2'-Deoxyinosine 5'-triphosphate | KEGG COMPOUND |
| 2'-Deoxyinosine-5'-triphosphate | KEGG COMPOUND |
| deoxyinosine 5'-triphosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C01345 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7401361 | Beilstein |