EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O7P2 |
| Net Charge | 0 |
| Average Mass | 586.687 |
| Monoisotopic Mass | 586.31883 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C30H52O7P2/c1-25(2)13-8-14-26(3)15-9-16-27(4)17-10-18-28(5)19-11-20-29(6)21-12-22-30(7)23-24-36-39(34,35)37-38(31,32)33/h13,15,17,19,21,23H,8-12,14,16,18,20,22,24H2,1-7H3,(H,34,35)(H2,31,32,33)/b26-15+,27-17+,28-19+,29-21+,30-23+ |
| InChIKey | NGFSMHKFTZROKJ-MMSZMYIBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-hexaprenyl diphosphate (CHEBI:17528) has role mouse metabolite (CHEBI:75771) |
| all-trans-hexaprenyl diphosphate (CHEBI:17528) is a all-trans-polyprenyl diphosphate (CHEBI:55337) |
| all-trans-hexaprenyl diphosphate (CHEBI:17528) is a hexaprenyl diphosphate (CHEBI:53047) |
| all-trans-hexaprenyl diphosphate (CHEBI:17528) is conjugate acid of all-trans-hexaprenyl diphosphate(3−) (CHEBI:58179) |
| Incoming Relation(s) |
| all-trans-hexaprenyl diphosphate(3−) (CHEBI:58179) is conjugate base of all-trans-hexaprenyl diphosphate (CHEBI:17528) |
| Synonyms | Source |
|---|---|
| (2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-yl trihydrogen diphosphate | ChEBI |
| all-trans-hexaprenyl diphosphate | ChEBI |
| all-trans-Hexaprenyl diphosphate | KEGG COMPOUND |