--- 
- 
  assignment: 1
  standardinchi: InChI=1S/C16H13ClN2O/c1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11/h2-9H,10H2,1H3
  standardinchikey: AAOVKJBEBIDNHE-UHFFFAOYSA-N