Chemical compound: PYR
PYR
Download: MDL
IUPAC name: PYRUVIC ACID
Formula: C3 H4 O3
SMILES: CC(=O)C(O)=O
INCHI: InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)
Heavy atoms: 6
Weight: 88.06
Links:  List of PDB entries
PDBe-Chem
HIC-Up
Ligand-Expo (RCSB)
eMolecules
ZINC
Binding statistics:  Aminoacids binding
PROSITE motifs binding
Secondary structure binding
Small 3D motifs binding