Chemical compound: OAF
OAF
Download: MDL
IUPAC name: 2,2-difluoro-3,3-dihydroxybutanedioic acid
Formula: C4 H4 F2 O6
SMILES: OC(=O)C(O)(O)C(F)(F)C(O)=O
INCHI: InChI=1S/C4H4F2O6/c5-3(6,1(7)8)4(11,12)2(9)10/h11-12H,(H,7,8)(H,9,10)
Heavy atoms: 12
Weight: 186.07
Links:  List of PDB entries
PDBe-Chem
HIC-Up
Ligand-Expo (RCSB)
eMolecules
ZINC
Binding statistics:  Aminoacids binding
Environment residues
PROSITE motifs binding
Secondary structure binding
Small 3D motifs binding