Chemical compound: OAA
OAA
Download: MDL
IUPAC name: OXALOACETATE ION
Formula: C4 H3 O5
SMILES: OC(=O)C(=O)CC([O-])=O
INCHI: InChI=1S/C4H4O5/c5-2(4(8)9)1-3(6)7/h1H2,(H,6,7)(H,8,9)/p-1
Heavy atoms: 9
Weight: 131.06
Links:  List of PDB entries
PDBe-Chem
HIC-Up
Ligand-Expo (RCSB)
eMolecules
ZINC
Binding statistics:  Aminoacids binding
Environment residues
PROSITE motifs binding
Secondary structure binding
Small 3D motifs binding