Chemical compound: MSE
MSE
Download: MDL
IUPAC name: SELENOMETHIONINE
Formula: C5 H11 N O2 Se
SMILES: C[Se]CC[CH](N)C(O)=O
INCHI: InChI=1S/C5H11NO2Se/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1
Heavy atoms: 9
Weight: 196.11
Links:  List of PDB entries
PDBe-Chem
HIC-Up
Ligand-Expo (RCSB)
eMolecules
ZINC
Binding statistics:  Aminoacids binding
PROSITE motifs binding
Secondary structure binding
Small 3D motifs binding