Chemical compound: MLA
MLA
Download: MDL
IUPAC name: MALONIC ACID
Formula: C3 H4 O4
SMILES: OC(=O)CC(O)=O
INCHI: InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)
Heavy atoms: 7
Weight: 104.06
Links:  List of PDB entries
PDBe-Chem
HIC-Up
Ligand-Expo (RCSB)
eMolecules
ZINC
Binding statistics:  Aminoacids binding
Environment residues
PROSITE motifs binding
Secondary structure binding
Small 3D motifs binding