Chemical compound: ICT
ICT
Download: MDL
IUPAC name: ISOCITRIC ACID
Formula: C6 H8 O7
SMILES: O[CH]([CH](CC(O)=O)C(O)=O)C(O)=O
INCHI: InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/t2-,4+/m0/s1
Heavy atoms: 13
Weight: 192.12
Links:  List of PDB entries
PDBe-Chem
HIC-Up
Ligand-Expo (RCSB)
eMolecules
ZINC
Binding statistics:  Aminoacids binding
Environment residues
PROSITE motifs binding
Secondary structure binding
Small 3D motifs binding