Chemical compound: GOL
GOL
Download: MDL
IUPAC name: GLYCEROL
Formula: C3 H8 O3
SMILES: OCC(O)CO
INCHI: InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2
Heavy atoms: 6
Weight: 92.09
Links:  List of PDB entries
PDBe-Chem
HIC-Up
Ligand-Expo (RCSB)
eMolecules
ZINC
Binding statistics:  Aminoacids binding
Environment residues
PROSITE motifs binding
Secondary structure binding
Small 3D motifs binding