Chemical compound: AKG
AKG
Download: MDL
IUPAC name: 2-OXOGLUTARIC ACID
Formula: C5 H6 O5
SMILES: OC(=O)CCC(=O)C(O)=O
INCHI: InChI=1S/C5H6O5/c6-3(5(9)10)1-2-4(7)8/h1-2H2,(H,7,8)(H,9,10)
Heavy atoms: 10
Weight: 146.10
Links:  List of PDB entries
PDBe-Chem
HIC-Up
Ligand-Expo (RCSB)
eMolecules
ZINC
Binding statistics:  Aminoacids binding
Environment residues
PROSITE motifs binding
Secondary structure binding
Small 3D motifs binding