InChI=1S/C21H29NO5/c1-20-7-5-13(23)9-12(20)10-16(22-27-11-18(25)26)19-14-3-4-17(24)21(14,2)8-6-15(19)20/h10,13-15,19,23H,3-9,11H2,1-2H3,(H,25,26)/t13-,14-,15-,19-,20-,21-/m0/s1 |
ZVQQBKJJJZODIH-XDLUYZMFSA-N |
[H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])C(C=C2C[C@@H](O)CC[C@]12C)=NOCC(O)=O |
|
immunological adjuvant
A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity.
|
|
immunological adjuvant
A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity.
|
|
View more via ChEBI Ontology
({[(3β)-3-hydroxy-17-oxoandrost-5-en-7-ylidene]amino}oxy)acetic acid
|
dehydroepiandrosterone-7-carboxymethyloxime
|
ChEBI
|
DHEA 7-O-(carboxymethyl)oxime
|
ChEBI
|
DHEA-7-CMO
|
ChEBI
|
2402395
|
Reaxys Registry Number
|
Reaxys
|
21541365
|
PubMed citation
|
Europe PMC
|
9140773
|
PubMed citation
|
Europe PMC
|
|