CHEBI:35267 - quaternary ammonium ion

Main ChEBI Ontology Automatic Xrefs Reactions Pathways Models
ChEBI Name quaternary ammonium ion
Definition A derivative of ammonium, NH4+, in which all four of the hydrogens bonded to nitrogen have been replaced with univalent (usually organyl) groups.
Stars This entity has been manually annotated by the ChEBI Team.
Secondary ChEBI IDs CHEBI:26470, CHEBI:8693
Download Molfile XML SDF
Formula NR4
Net Charge +1
Average Mass (excl. R groups) 14.00670
Monoisotopic Mass (excl. R groups) 14.00307
SMILES [*][N+]([*])([*])[*]
ChEBI Ontology
Outgoing quaternary ammonium ion (CHEBI:35267) has parent hydride ammonium (CHEBI:28938)
quaternary ammonium ion (CHEBI:35267) is a ammonium ion (CHEBI:35274)
quaternary ammonium ion (CHEBI:35267) is a organic cation (CHEBI:25697)
Incoming quaternary ammonium salt (CHEBI:35273) has part quaternary ammonium ion (CHEBI:35267)
quaternary nitrogen compound (CHEBI:26469) has part quaternary ammonium ion (CHEBI:35267)
γ-butyrobetainyl-CoA (CHEBI:61517) is a quaternary ammonium ion (CHEBI:35267)
(13S,14R)-1,13-dihydroxy-N-methylcanadine (CHEBI:141639) is a quaternary ammonium ion (CHEBI:35267)
(13S,14R)-1,8-dihydroxy-13-O-acetyl-N-methylcanadine (CHEBI:141642) is a quaternary ammonium ion (CHEBI:35267)
(13S,14R)-1-hydroxy-13-O-acetyl-N-methylcanadine (CHEBI:141640) is a quaternary ammonium ion (CHEBI:35267)
(1R,2S,1'R,2'S)-doxacurium (CHEBI:59820) is a quaternary ammonium ion (CHEBI:35267)
(1S,2R,1'S,2'R)-doxacurium (CHEBI:59822) is a quaternary ammonium ion (CHEBI:35267)
(S)-1,2,9,10-tetramethoxy-6-methylaporphine(1+) (CHEBI:134213) is a quaternary ammonium ion (CHEBI:35267)
(S)-1-hydroxy-N-methylcanadine (CHEBI:141633) is a quaternary ammonium ion (CHEBI:35267)
(S)-cis-N-methylstylopine (CHEBI:444) is a quaternary ammonium ion (CHEBI:35267)
(S)-N-methylcanadine (CHEBI:16512) is a quaternary ammonium ion (CHEBI:35267)
(S)-magnoflorine (CHEBI:6641) is a quaternary ammonium ion (CHEBI:35267)
1,1'-hexadecane-1,16-diylbis(1-methylpyrrolidinium) (CHEBI:77866) is a quaternary ammonium ion (CHEBI:35267)
2-fluorobenzenaminium (CHEBI:566835) is a quaternary ammonium ion (CHEBI:35267)
2-trimethylaminoethylphosphonic acid (CHEBI:7347) is a quaternary ammonium ion (CHEBI:35267)
3-(4-carboxybutanamido)-1-{4-[(2-hydroxyethyl)carbamoyl]benzyl}-1-methylpiperidinium (CHEBI:67219) is a quaternary ammonium ion (CHEBI:35267)
3-dehydrocarnitinium (CHEBI:16758) is a quaternary ammonium ion (CHEBI:35267)
3-dehydrocarnityl CoA (CHEBI:85886) is a quaternary ammonium ion (CHEBI:35267)
3-fluorobenzenaminium (CHEBI:566836) is a quaternary ammonium ion (CHEBI:35267)
3-hydroxy-N6,N6,N6-trimethyl-L-lysine (CHEBI:15786) is a quaternary ammonium ion (CHEBI:35267)
4-(trimethylammonio)but-2-enoic acid (CHEBI:48867) is a quaternary ammonium ion (CHEBI:35267)
4-(trimethylammonio)butanoic acid (CHEBI:1941) is a quaternary ammonium ion (CHEBI:35267)
4-(trimethylammonium)benzenediazonium (CHEBI:60610) is a quaternary ammonium ion (CHEBI:35267)
4-DAMP(1+) (CHEBI:73467) is a quaternary ammonium ion (CHEBI:35267)
4-fluorobenzenaminium (CHEBI:566837) is a quaternary ammonium ion (CHEBI:35267)
m-trimethylammonio(2,2,2-trifluoro-1,1-dihydroxyethyl)benzene (CHEBI:44394) is a quaternary ammonium ion (CHEBI:35267)
meso-doxacurium (CHEBI:59818) is a quaternary ammonium ion (CHEBI:35267)
N,N,N-trimethyl-N-(4-oxopentyl)ammonium (CHEBI:44470) is a quaternary ammonium ion (CHEBI:35267)
N,N,N-trimethylglycinium (CHEBI:41139) is a quaternary ammonium ion (CHEBI:35267)
N,N,N-trimethylglycyl-CoA (CHEBI:85888) is a quaternary ammonium ion (CHEBI:35267)
N,N-dimethyl-L-prolinium (CHEBI:44813) is a quaternary ammonium ion (CHEBI:35267)
N-methyl-α-berbine (CHEBI:50538) is a quaternary ammonium ion (CHEBI:35267)
N-methylbulbocapnine(1+) (CHEBI:134217) is a quaternary ammonium ion (CHEBI:35267)
Nα,Nα,Nα-trimethyl-L-histidinium(1+) (CHEBI:67049) is a quaternary ammonium ion (CHEBI:35267)
N4-bis(aminopropyl)spermidine(1+) (CHEBI:83553) is a quaternary ammonium ion (CHEBI:35267)
N4-bis(aminopropyl)spermidine(5+) (CHEBI:82771) is a quaternary ammonium ion (CHEBI:35267)
O-acetylcarnitinium (CHEBI:15960) is a quaternary ammonium ion (CHEBI:35267)
p-azophenyltrimethylammonium (CHEBI:60567) is a quaternary ammonium ion (CHEBI:35267)
acetyl-β-methylthiocholine (CHEBI:73475) is a quaternary ammonium ion (CHEBI:35267)
aclidinium (CHEBI:65346) is a quaternary ammonium ion (CHEBI:35267)
acylcholine (CHEBI:35287) is a quaternary ammonium ion (CHEBI:35267)
ambenonium (CHEBI:2627) is a quaternary ammonium ion (CHEBI:35267)
atracurium (CHEBI:2914) is a quaternary ammonium ion (CHEBI:35267)
betaine aldehyde (CHEBI:15710) is a quaternary ammonium ion (CHEBI:35267)
betaine aldehyde hydrate (CHEBI:15870) is a quaternary ammonium ion (CHEBI:35267)
bethanechol (CHEBI:3084) is a quaternary ammonium ion (CHEBI:35267)
bretylium (CHEBI:3172) is a quaternary ammonium ion (CHEBI:35267)
butyrylthiocholine (CHEBI:41055) is a quaternary ammonium ion (CHEBI:35267)
carnitinamide (CHEBI:48604) is a quaternary ammonium ion (CHEBI:35267)
carnitinium (CHEBI:3424) is a quaternary ammonium ion (CHEBI:35267)
cetyltrimethylammonium ion (CHEBI:39561) is a quaternary ammonium ion (CHEBI:35267)
chlormequat (CHEBI:81850) is a quaternary ammonium ion (CHEBI:35267)
choline hydrogen sulfate (CHEBI:52859) is a quaternary ammonium ion (CHEBI:35267)
cholines (CHEBI:23217) is a quaternary ammonium ion (CHEBI:35267)
cisatracurium (CHEBI:140621) is a quaternary ammonium ion (CHEBI:35267)
clidinium (CHEBI:3743) is a quaternary ammonium ion (CHEBI:35267)
cyclanoline (CHEBI:76923) is a quaternary ammonium ion (CHEBI:35267)
decamethonium (CHEBI:41934) is a quaternary ammonium ion (CHEBI:35267)
decyltrimethylammonium ion (CHEBI:55325) is a quaternary ammonium ion (CHEBI:35267)
demarcarium (CHEBI:59719) is a quaternary ammonium ion (CHEBI:35267)
diphthamide (CHEBI:15949) is a quaternary ammonium ion (CHEBI:35267)
diphthamide zwitterion (CHEBI:57580) is a quaternary ammonium ion (CHEBI:35267)
diphthine (CHEBI:18054) is a quaternary ammonium ion (CHEBI:35267)
dodecyltrimethylammonium ion (CHEBI:41378) is a quaternary ammonium ion (CHEBI:35267)
doxacurium (CHEBI:4706) is a quaternary ammonium ion (CHEBI:35267)
ecothiopate (CHEBI:4753) is a quaternary ammonium ion (CHEBI:35267)
edrophonium (CHEBI:251408) is a quaternary ammonium ion (CHEBI:35267)
ethyl green(1+) (CHEBI:88289) is a quaternary ammonium ion (CHEBI:35267)
ethyltrimethylammonium (CHEBI:271685) is a quaternary ammonium ion (CHEBI:35267)
FM 1-43(2+) (CHEBI:52850) is a quaternary ammonium ion (CHEBI:35267)
FM 4-64(2+) (CHEBI:52856) is a quaternary ammonium ion (CHEBI:35267)
iodine green(2+) (CHEBI:90181) is a quaternary ammonium ion (CHEBI:35267)
ipratropium (CHEBI:5956) is a quaternary ammonium ion (CHEBI:35267)
JOJO-1(4+) (CHEBI:52863) is a quaternary ammonium ion (CHEBI:35267)
LoLo-1(4+) (CHEBI:52867) is a quaternary ammonium ion (CHEBI:35267)
mepiquat (CHEBI:90548) is a quaternary ammonium ion (CHEBI:35267)
methacholine (CHEBI:6804) is a quaternary ammonium ion (CHEBI:35267)
methyl green(2+) (CHEBI:87650) is a quaternary ammonium ion (CHEBI:35267)
methylated tertiary amine (CHEBI:137983) is a quaternary ammonium ion (CHEBI:35267)
methyltrioctylammonium (CHEBI:75293) is a quaternary ammonium ion (CHEBI:35267)
N-terminal N,N,N-trimethyl-L-glycyl-L-lysyl-L-glutamate residue (CHEBI:142600) is a quaternary ammonium ion (CHEBI:35267)
neostigmine (CHEBI:7514) is a quaternary ammonium ion (CHEBI:35267)
octyltrimethylammonium ion (CHEBI:55321) is a quaternary ammonium ion (CHEBI:35267)
oxotremorine M (CHEBI:38322) is a quaternary ammonium ion (CHEBI:35267)
penotonium cation (CHEBI:59068) is a quaternary ammonium ion (CHEBI:35267)
phosphatidylcholine(1+) (CHEBI:49183) is a quaternary ammonium ion (CHEBI:35267)
Po-Pro-1(2+) (CHEBI:52885) is a quaternary ammonium ion (CHEBI:35267)
Po-Pro-3(2+) (CHEBI:52886) is a quaternary ammonium ion (CHEBI:35267)
PoPo-1(4+) (CHEBI:52887) is a quaternary ammonium ion (CHEBI:35267)
PoPo-3(4+) (CHEBI:52888) is a quaternary ammonium ion (CHEBI:35267)
propidium (CHEBI:51246) is a quaternary ammonium ion (CHEBI:35267)
rocuronium (CHEBI:8884) is a quaternary ammonium ion (CHEBI:35267)
sphingoid-1-phosphocholine(1+) (CHEBI:85171) is a quaternary ammonium ion (CHEBI:35267)
sphingomyelin d18:1(1+) (CHEBI:62490) is a quaternary ammonium ion (CHEBI:35267)
sphingosylphosphocholine acid (CHEBI:52897) is a quaternary ammonium ion (CHEBI:35267)
succinylcholine (CHEBI:45652) is a quaternary ammonium ion (CHEBI:35267)
tembetarine (CHEBI:136682) is a quaternary ammonium ion (CHEBI:35267)
tetrabutylammonium (CHEBI:45825) is a quaternary ammonium ion (CHEBI:35267)
tetraethylammonium (CHEBI:44296) is a quaternary ammonium ion (CHEBI:35267)
tetrafluoroammonium (CHEBI:30233) is a quaternary ammonium ion (CHEBI:35267)
tetramethylammonium (CHEBI:46020) is a quaternary ammonium ion (CHEBI:35267)
tetrapentylammonium (CHEBI:35009) is a quaternary ammonium ion (CHEBI:35267)
tetrapropylammonium (CHEBI:55319) is a quaternary ammonium ion (CHEBI:35267)
tiotropium (CHEBI:90960) is a quaternary ammonium ion (CHEBI:35267)
ToTo-1(4+) (CHEBI:52929) is a quaternary ammonium ion (CHEBI:35267)
tridihexethyl (CHEBI:9701) is a quaternary ammonium ion (CHEBI:35267)
trimethylphenylammonium (CHEBI:85318) is a quaternary ammonium ion (CHEBI:35267)
umeclidinium (CHEBI:79041) is a quaternary ammonium ion (CHEBI:35267)
vecuronium (CHEBI:9939) is a quaternary ammonium ion (CHEBI:35267)
Yo-Pro-1(2+) (CHEBI:52936) is a quaternary ammonium ion (CHEBI:35267)
Yo-Pro-3(2+) (CHEBI:52946) is a quaternary ammonium ion (CHEBI:35267)
YoYo-1(4+) (CHEBI:52947) is a quaternary ammonium ion (CHEBI:35267)
quaternary ammonium ion
Synonyms Sources
Quaternary amine KEGG COMPOUND
quaternary ammonium UniProt
quaternary ammonium ions ChEBI
Manual Xref Database
View more database links
Last Modified
06 December 2018