CHEBI:35274 - ammonium ion derivative

Main ChEBI Ontology Automatic Xrefs Reactions Pathways Models
ChEBI Name ammonium ion derivative
Definition A derivative of ammonium, NH4+, in which one (or more) of the hydrogens bonded to the nitrogen have been replaced with univalent organyl groups. The substituting carbon of the organyl group must not itself be directly attached to a heteroatom (thereby excluding protonated amides, hemiaminals, etc).
Stars This entity has been manually annotated by the ChEBI Team.
ChEBI Ontology
Outgoing ammonium ion derivative (CHEBI:35274) has parent hydride ammonium (CHEBI:28938)
ammonium ion derivative (CHEBI:35274) is a nitrogen molecular entity (CHEBI:51143)
ammonium ion derivative (CHEBI:35274) is a polyatomic cation (CHEBI:33702)
Incoming ammonium compound (CHEBI:35276) has part ammonium ion derivative (CHEBI:35274)
γ-carboxy-L-glutamic acid zwitterion(2−) (CHEBI:61938) is a ammonium ion derivative (CHEBI:35274)
(±)-5-[3-(tert-butylammonio)-2-hydroxypropoxy]-1,2,3,4-tetrahydro-1-naphthol(1+) (CHEBI:58611) is a ammonium ion derivative (CHEBI:35274)
(±)-5-[3-(tert-butylammonio)-2-hydroxypropoxy]-3,4-dihydronaphthalen-1(2H)-one(1+) (CHEBI:58612) is a ammonium ion derivative (CHEBI:35274)
(−)-(R)-19-O-acetyltabersonine(1+) (CHEBI:144377) is a ammonium ion derivative (CHEBI:35274)
(−)-(R)-19-hydroxytabersonine(1+) (CHEBI:144372) is a ammonium ion derivative (CHEBI:35274)
(−)-coronaridine(1+) (CHEBI:146232) is a ammonium ion derivative (CHEBI:35274)
(−)-echitovenine(1+) (CHEBI:144384) is a ammonium ion derivative (CHEBI:35274)
(−)-ephedrinium (CHEBI:57295) is a ammonium ion derivative (CHEBI:35274)
(−)-minovincinine(1+) (CHEBI:144373) is a ammonium ion derivative (CHEBI:35274)
(−)-vincadifformine(1+) (CHEBI:142771) is a ammonium ion derivative (CHEBI:35274)
(−)-voacangine(1+) (CHEBI:146230) is a ammonium ion derivative (CHEBI:35274)
(+)-echitovenine(1+) (CHEBI:144379) is a ammonium ion derivative (CHEBI:35274)
(+)-minovincinine(1+) (CHEBI:144371) is a ammonium ion derivative (CHEBI:35274)
(+)-vincadifformine(1+) (CHEBI:142830) is a ammonium ion derivative (CHEBI:35274)
(16R)-deshydroxymethyl-stemmadenine(1+) (CHEBI:142670) is a ammonium ion derivative (CHEBI:35274)
(16S)-deshydroxymethyl-stemmadenine(1+) (CHEBI:142671) is a ammonium ion derivative (CHEBI:35274)
(1R)-1-phenylethanaminium (CHEBI:141112) is a ammonium ion derivative (CHEBI:35274)
(1R,2R)-pseudoephedrine(1+) (CHEBI:149674) is a ammonium ion derivative (CHEBI:35274)
(1R,3S)-3-(adamantan-1-yl)-1-(ammoniomethyl)-3,4-dihydroisochromene-5,6-diol(1+) (CHEBI:64079) is a ammonium ion derivative (CHEBI:35274)
(1S)-1-phenylethanaminium (CHEBI:141108) is a ammonium ion derivative (CHEBI:35274)
(1S,2R)-5-methoxy-1-methyl-2-(propylammonio)tetralin(1+) (CHEBI:64118) is a ammonium ion derivative (CHEBI:35274)
(1S,2R)-ephedrine(1+) (CHEBI:149673) is a ammonium ion derivative (CHEBI:35274)
(1S,2S,3R,5S)-3,5-diammoniocyclohexane-1,2-diol (CHEBI:72342) is a ammonium ion derivative (CHEBI:35274)
(2E,5S,6E,8E,10E)-1-ammoniododeca-2,6,8,10-tetraen-5-ol (CHEBI:142545) is a ammonium ion derivative (CHEBI:35274)
(2R)-2-hydroxypropylammonium (CHEBI:42677) is a ammonium ion derivative (CHEBI:35274)
(2S,3S,5R,10R,12S,14S,15R,16R)-2-amino-12,16-dimethylicosane-3,5,10,14,15-pentol(1+) (CHEBI:62526) is a ammonium ion derivative (CHEBI:35274)
(2S)-2-carbamoylpyrrolidin-1-ium (CHEBI:58495) is a ammonium ion derivative (CHEBI:35274)
(3R)-3-(tert-butylcarbamoyl)piperazin-1-ium (CHEBI:60254) is a ammonium ion derivative (CHEBI:35274)
(4aR,10bS)-noroxomaritidine(1+) (CHEBI:133996) is a ammonium ion derivative (CHEBI:35274)
(4aS,10bR)-noroxomaritidine(1+) (CHEBI:133995) is a ammonium ion derivative (CHEBI:35274)
(4aS,10bR)-oxomaritidine(1+) (CHEBI:146208) is a ammonium ion derivative (CHEBI:35274)
(6ξ)-12-methoxy-18-carbonyl-2α-ibogamin-6-ium (CHEBI:146275) is a ammonium ion derivative (CHEBI:35274)
(6S)-6-hydroxyhyoscyaminium (CHEBI:57459) is a ammonium ion derivative (CHEBI:35274)
(7S)-salutaridinol(1+) (CHEBI:58463) is a ammonium ion derivative (CHEBI:35274)
(R)-2-methylpyrrolidinium (CHEBI:78222) is a ammonium ion derivative (CHEBI:35274)
(R)-6-hydroxynicotinium (CHEBI:58413) is a ammonium ion derivative (CHEBI:35274)
(R)-adrenaline(1+) (CHEBI:71406) is a ammonium ion derivative (CHEBI:35274)
(R)-benproperine(1+) (CHEBI:78391) is a ammonium ion derivative (CHEBI:35274)
(R)-fluoxetine(1+) (CHEBI:86993) is a ammonium ion derivative (CHEBI:35274)
(R)-laudanosine(1+) (CHEBI:134210) is a ammonium ion derivative (CHEBI:35274)
(R)-methcathinone(1+) (CHEBI:149676) is a ammonium ion derivative (CHEBI:35274)
(R)-nefopam(1+) (CHEBI:88325) is a ammonium ion derivative (CHEBI:35274)
(R)-nicotinium(1+) (CHEBI:79008) is a ammonium ion derivative (CHEBI:35274)
(R)-nipecotamide(1+) (CHEBI:60118) is a ammonium ion derivative (CHEBI:35274)
(R)-noradrenaline(1+) (CHEBI:72587) is a ammonium ion derivative (CHEBI:35274)
(R)-orciprenaline(1+) (CHEBI:83340) is a ammonium ion derivative (CHEBI:35274)
(R)-piperazin-4-ium-2-carboxamide(1+) (CHEBI:58916) is a ammonium ion derivative (CHEBI:35274)
(R)-prasugrel(1+) (CHEBI:87727) is a ammonium ion derivative (CHEBI:35274)
(R)-reticulinium(1+) (CHEBI:58144) is a ammonium ion derivative (CHEBI:35274)
(R)-SKF 38393(1+) (CHEBI:131806) is a ammonium ion derivative (CHEBI:35274)
(R)-tetrahydropapaverine(1+) (CHEBI:134211) is a ammonium ion derivative (CHEBI:35274)
(R)-tetrindole(1+) (CHEBI:77793) is a ammonium ion derivative (CHEBI:35274)
(R,R)-asenapine(1+) (CHEBI:71251) is a ammonium ion derivative (CHEBI:35274)
(R,R)-tramadol(1+) (CHEBI:75737) is a ammonium ion derivative (CHEBI:35274)
(R,S,S,S)-nebivolol(1+) (CHEBI:132915) is a ammonium ion derivative (CHEBI:35274)
(RS)-coclaurinium (CHEBI:58481) is a ammonium ion derivative (CHEBI:35274)
(RS)-norcoclaurinium (CHEBI:58482) is a ammonium ion derivative (CHEBI:35274)
(S)-2-methyl-1-(4-methylisoquinoline-5-sulfonyl)-1,4-diazepane(2+) (CHEBI:138382) is a ammonium ion derivative (CHEBI:35274)
(S)-3'-hydroxy-N-methylcoclaurinium(1+) (CHEBI:58010) is a ammonium ion derivative (CHEBI:35274)
(S)-6-hydroxynicotinium(1+) (CHEBI:58182) is a ammonium ion derivative (CHEBI:35274)
(S)-N-methylcoclaurinium(1+) (CHEBI:57993) is a ammonium ion derivative (CHEBI:35274)
(S)-atropinium (CHEBI:58164) is a ammonium ion derivative (CHEBI:35274)
(S)-benproperine(1+) (CHEBI:78392) is a ammonium ion derivative (CHEBI:35274)
(S)-coclaurinium (CHEBI:57581) is a ammonium ion derivative (CHEBI:35274)
(S)-codamine(1+) (CHEBI:143148) is a ammonium ion derivative (CHEBI:35274)
(S)-fluoxetine(1+) (CHEBI:86995) is a ammonium ion derivative (CHEBI:35274)
(S)-glaucine(1+) (CHEBI:134212) is a ammonium ion derivative (CHEBI:35274)
(S)-methcathinone(1+) (CHEBI:145731) is a ammonium ion derivative (CHEBI:35274)
(S)-nefopam(1+) (CHEBI:88324) is a ammonium ion derivative (CHEBI:35274)
(S)-nicotinium(1+) (CHEBI:59806) is a ammonium ion derivative (CHEBI:35274)
(S)-norcoclaurinium(1+) (CHEBI:58253) is a ammonium ion derivative (CHEBI:35274)
(S)-orciprenaline(1+) (CHEBI:83338) is a ammonium ion derivative (CHEBI:35274)
(S)-piperazin-4-ium-2-carboxamide(1+) (CHEBI:58919) is a ammonium ion derivative (CHEBI:35274)
(S)-prasugrel(1+) (CHEBI:87726) is a ammonium ion derivative (CHEBI:35274)
(S)-reticulinium(1+) (CHEBI:57873) is a ammonium ion derivative (CHEBI:35274)
(S)-SKF 38393(1+) (CHEBI:131807) is a ammonium ion derivative (CHEBI:35274)
(S)-tetrindole(1+) (CHEBI:77797) is a ammonium ion derivative (CHEBI:35274)
(S)-verapamil(1+) (CHEBI:77738) is a ammonium ion derivative (CHEBI:35274)
(S,R,R,R)-nebivolol(1+) (CHEBI:132916) is a ammonium ion derivative (CHEBI:35274)
(S,S)-2,5-di-(p-hydroxybenzyl)piperazine(1+) (CHEBI:145882) is a ammonium ion derivative (CHEBI:35274)
(S,S)-asenapine(1+) (CHEBI:71252) is a ammonium ion derivative (CHEBI:35274)
(S,S)-formoterol(1+) (CHEBI:63110) is a ammonium ion derivative (CHEBI:35274)
(S,S)-tramadol(1+) (CHEBI:75738) is a ammonium ion derivative (CHEBI:35274)
1,1'-[1,9-bis(dimethylammonio)nonane-1,9-diyl]bis{4-[(Z)-(3-methyl-1,3-benzothiazol-2(3H)-ylidene)methyl]quinolinium} (CHEBI:46019) is a ammonium ion derivative (CHEBI:35274)
1,2-distearoylphosphatidylethanolaminium (CHEBI:47769) is a ammonium ion derivative (CHEBI:35274)
1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine(1+) (CHEBI:139161) is a ammonium ion derivative (CHEBI:35274)
1-(5-isoquinolinesulfonyl)-2-methylpiperazine(2+) (CHEBI:83442) is a ammonium ion derivative (CHEBI:35274)
1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidinium(1+) (CHEBI:64146) is a ammonium ion derivative (CHEBI:35274)
1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazinediium(2+) (CHEBI:64092) is a ammonium ion derivative (CHEBI:35274)
1-[6-carboxy-8-(2,4-difluorophenyl)-3-fluoro-5-oxo-5,8-dihydro-1,8-naphthyridin-2-yl]pyrrolidin-3-aminium (CHEBI:77588) is a ammonium ion derivative (CHEBI:35274)
1-benzyl-1,2,3,4-tetrahydroisoquinolin-2-ium (CHEBI:57902) is a ammonium ion derivative (CHEBI:35274)
1-benzyl-2-methyl-1,2,3,4-tetrahydroisoquinolinium (CHEBI:57598) is a ammonium ion derivative (CHEBI:35274)
1-butyl-2-[(2,6-dimethylphenyl)carbamoyl]piperidinium (CHEBI:77457) is a ammonium ion derivative (CHEBI:35274)
10-deoxymethymycin(1+) (CHEBI:63307) is a ammonium ion derivative (CHEBI:35274)
13-(2-methylcrotonoyloxy)lupaninium (CHEBI:58460) is a ammonium ion derivative (CHEBI:35274)
13-deoxydaunorubicin(1+) (CHEBI:75297) is a ammonium ion derivative (CHEBI:35274)
13-dihydrodaunorubicin(1+) (CHEBI:75296) is a ammonium ion derivative (CHEBI:35274)
13-hydroxylupaninium (CHEBI:58446) is a ammonium ion derivative (CHEBI:35274)
15α-stemmadenine(1+) (CHEBI:142674) is a ammonium ion derivative (CHEBI:35274)
15-methylhexadecasphing-4-enine-1-phosphocholine(1+) (CHEBI:71021) is a ammonium ion derivative (CHEBI:35274)
16-methoxytabersoninium(1+) (CHEBI:58930) is a ammonium ion derivative (CHEBI:35274)
17-O-acetylajmalinium (CHEBI:58679) is a ammonium ion derivative (CHEBI:35274)
17-hydroxylupanine(1+) (CHEBI:64262) is a ammonium ion derivative (CHEBI:35274)
19-O-acetylhörhammericine(1+) (CHEBI:144376) is a ammonium ion derivative (CHEBI:35274)
1D-myo-inositol 2-(L-cysteiniumylamino)-2-deoxy-α-D-glucopyranoside (CHEBI:58887) is a ammonium ion derivative (CHEBI:35274)
1D-myo-inositol 2-ammonio-2-deoxy-α-D-glucopyranoside (CHEBI:58886) is a ammonium ion derivative (CHEBI:35274)
2'''-acetyl-6'''-hydroxyneomycin C(4+) (CHEBI:65030) is a ammonium ion derivative (CHEBI:35274)
2'-N-acetylparomamine(2+) (CHEBI:65010) is a ammonium ion derivative (CHEBI:35274)
2'-deamino-2'-hydroxy-6'-dehydroparomamine(2+) (CHEBI:67214) is a ammonium ion derivative (CHEBI:35274)
2'-deamino-2'-hydroxyneamine(3+) (CHEBI:67213) is a ammonium ion derivative (CHEBI:35274)
2'-deamino-2'-hydroxyparomamine(2+) (CHEBI:65071) is a ammonium ion derivative (CHEBI:35274)
2'-oxokanamycin(4+) (CHEBI:72757) is a ammonium ion derivative (CHEBI:35274)
2,5-diammoniohexanoate (CHEBI:57950) is a ammonium ion derivative (CHEBI:35274)
2,6-diamino-2,3,6-trideoxy-α-D-glucose(2+) (CHEBI:72339) is a ammonium ion derivative (CHEBI:35274)
2,6-dihydroxypseudooxynicotinium(1+) (CHEBI:66944) is a ammonium ion derivative (CHEBI:35274)
2-[3-carboxy-3-(methylammonio)propyl]-L-histidine (CHEBI:16475) is a ammonium ion derivative (CHEBI:35274)
2-ammonio-2-deoxy-D-glucopyranose (CHEBI:58723) is a ammonium ion derivative (CHEBI:35274)
2-arylethylammomium(1+) (CHEBI:77827) is a ammonium ion derivative (CHEBI:35274)
2-chloro-1,4-phenylenediaminium (CHEBI:76599) is a ammonium ion derivative (CHEBI:35274)
2-deoxy-scyllo-inosamine(1+) (CHEBI:65003) is a ammonium ion derivative (CHEBI:35274)
2-deoxystreptamine(1+) (CHEBI:72447) is a ammonium ion derivative (CHEBI:35274)
2-deoxystreptamine(2+) (CHEBI:65069) is a ammonium ion derivative (CHEBI:35274)
2-dimethylammonioethyl chloride (CHEBI:78154) is a ammonium ion derivative (CHEBI:35274)
2-phenylethanaminium (CHEBI:225237) is a ammonium ion derivative (CHEBI:35274)
2-{[(2E)-3-iodoprop-2-en-1-yl](propyl)ammonio}tetralin-7-ol(1+) (CHEBI:64138) is a ammonium ion derivative (CHEBI:35274)
2-{[(4-methoxybenzyl)(methyl)amino]methyl}-2-methylpropane-1,3-diol(1+) (CHEBI:139164) is a ammonium ion derivative (CHEBI:35274)
3''-deamino-3''-hydroxykanamycin B(4+) (CHEBI:72944) is a ammonium ion derivative (CHEBI:35274)
3''-deamino-3''-hydroxykanamycin C(3+) (CHEBI:72945) is a ammonium ion derivative (CHEBI:35274)
3''-deamino-3''-hydroxykanamycin X(2+) (CHEBI:72946) is a ammonium ion derivative (CHEBI:35274)
3',4'-difluoro-N-{4'-fluoro-6-[(3S)-pyrrolidin-3-yloxy][biphenyl]-3-yl}-6-[(3S)-pyrrolidin-3-yloxy][biphenyl]-3-carboxamide(2+) (CHEBI:147295) is a ammonium ion derivative (CHEBI:35274)
3'-N-debenzoyl-2'-deoxytaxol(1+) (CHEBI:79186) is a ammonium ion derivative (CHEBI:35274)
3'-N-debenzoyltaxol(1+) (CHEBI:63863) is a ammonium ion derivative (CHEBI:35274)
3'-demethylstaurosporinium(1+) (CHEBI:57473) is a ammonium ion derivative (CHEBI:35274)
3,3'-neotrehalosadiamine(2+) (CHEBI:75053) is a ammonium ion derivative (CHEBI:35274)
3,3,3-tetraminium(4+) (CHEBI:58704) is a ammonium ion derivative (CHEBI:35274)
3-(methylaminomethyl)indole(1+) (CHEBI:136515) is a ammonium ion derivative (CHEBI:35274)
3-[5-cyano-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-1-yl]-N,N-dimethylpropan-1-aminium (CHEBI:77408) is a ammonium ion derivative (CHEBI:35274)
3-ammonio-2,3-dideoxy-scyllo-inosose(1+) (CHEBI:65002) is a ammonium ion derivative (CHEBI:35274)
3-ammoniopropanal (CHEBI:58374) is a ammonium ion derivative (CHEBI:35274)
3-hydroxyquininium (CHEBI:58234) is a ammonium ion derivative (CHEBI:35274)
3-methylthiopropylaminium (CHEBI:57866) is a ammonium ion derivative (CHEBI:35274)
4'-O-methylnorbelladine(1+) (CHEBI:133993) is a ammonium ion derivative (CHEBI:35274)
4-(3-chlorophenyl)-1-(2-hydroxy-3,3-diphenylpropyl)piperazin-1-ium(1+) (CHEBI:64059) is a ammonium ion derivative (CHEBI:35274)
4-O-methylrhodomycin D(1+) (CHEBI:77074) is a ammonium ion derivative (CHEBI:35274)
4-O-phosphohygromycin B(1+) (CHEBI:59917) is a ammonium ion derivative (CHEBI:35274)
4-amino-5-ammoniomethyl-2-methylpyrimidine (CHEBI:63416) is a ammonium ion derivative (CHEBI:35274)
4-ammoniobutanal (CHEBI:58264) is a ammonium ion derivative (CHEBI:35274)
4-fluoro-N-{2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl}benzamide(1+) (CHEBI:64100) is a ammonium ion derivative (CHEBI:35274)
4-hydroxytryptamine(1+) (CHEBI:139069) is a ammonium ion derivative (CHEBI:35274)
4-methoxy-3-indolylmethylamine(1+) (CHEBI:136935) is a ammonium ion derivative (CHEBI:35274)
4-{2-[(2-hydroxybenzyl)amino]ethyl}-2,5-dimethoxybenzonitrile(1+) (CHEBI:145983) is a ammonium ion derivative (CHEBI:35274)
5''-phosphoribostamycin(2+) (CHEBI:65082) is a ammonium ion derivative (CHEBI:35274)
5-O-β-D-mycaminosyl-20-oxotylonolide(1+) (CHEBI:76803) is a ammonium ion derivative (CHEBI:35274)
5-O-β-D-mycaminosyltylactone(1+) (CHEBI:76802) is a ammonium ion derivative (CHEBI:35274)
5-O-mycaminosyltylonolide(1+) (CHEBI:76804) is a ammonium ion derivative (CHEBI:35274)
5-amino-5-(4-hydroxybenzyl)-6-(D-ribitylimino)-5,6-dihydrouracil(1+) (CHEBI:85512) is a ammonium ion derivative (CHEBI:35274)
5-aminomethyl-2-thiouridine(1+) (CHEBI:73769) is a ammonium ion derivative (CHEBI:35274)
5-ammoniopentanal (CHEBI:144896) is a ammonium ion derivative (CHEBI:35274)
5-ammoniopentanamide (CHEBI:58382) is a ammonium ion derivative (CHEBI:35274)
5-hydroxykynurenaminium(1+) (CHEBI:62214) is a ammonium ion derivative (CHEBI:35274)
5-methoxytryptamine(1+) (CHEBI:166874) is a ammonium ion derivative (CHEBI:35274)
5-nonyloxytryptaminium(1+) (CHEBI:64150) is a ammonium ion derivative (CHEBI:35274)
6'''-hydroxyneomycin C(5+) (CHEBI:65031) is a ammonium ion derivative (CHEBI:35274)
6'''-oxoneomycin C(5+) (CHEBI:65068) is a ammonium ion derivative (CHEBI:35274)
6''-O-carbamoylkanamycin A(4+) (CHEBI:73675) is a ammonium ion derivative (CHEBI:35274)
6'-oxoparomamine(3+) (CHEBI:65016) is a ammonium ion derivative (CHEBI:35274)
6-(α-D-glucosazaniumyl)-1D-myo-inositol (CHEBI:58700) is a ammonium ion derivative (CHEBI:35274)
6-O-methylnorlaudanosolinium (CHEBI:57578) is a ammonium ion derivative (CHEBI:35274)
6-hydroxy-N-methylmyosmine(1+) (CHEBI:87164) is a ammonium ion derivative (CHEBI:35274)
6-hydroxypseudooxynicotinium(1+) (CHEBI:58682) is a ammonium ion derivative (CHEBI:35274)
7''-O-phosphohygromycin B(1+) (CHEBI:57929) is a ammonium ion derivative (CHEBI:35274)
7,8-diaminononanoate cation (CHEBI:58500) is a ammonium ion derivative (CHEBI:35274)
7-O-acetylsalutaridinol(1+) (CHEBI:57672) is a ammonium ion derivative (CHEBI:35274)
7-ammoniomethyl-7-deazaguanine (CHEBI:58703) is a ammonium ion derivative (CHEBI:35274)
ent-diltiazem(1+) (CHEBI:82816) is a ammonium ion derivative (CHEBI:35274)
m-tyraminium (CHEBI:144800) is a ammonium ion derivative (CHEBI:35274)
N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-2-(2,6-dimethoxyphenoxy)ethanaminium(1+) (CHEBI:64097) is a ammonium ion derivative (CHEBI:35274)
N-(3-acetamidopropyl)-4-ammoniobutanal (CHEBI:58858) is a ammonium ion derivative (CHEBI:35274)
N-(3-ammoniopropyl)-4-ammoniobutanal (CHEBI:58869) is a ammonium ion derivative (CHEBI:35274)
N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide(1+) (CHEBI:75369) is a ammonium ion derivative (CHEBI:35274)
N-(ammoniomethyl)urea (CHEBI:57431) is a ammonium ion derivative (CHEBI:35274)
N-[(E)-4-ammoniobutylidene]propane-1,3-diaminium (CHEBI:58732) is a ammonium ion derivative (CHEBI:35274)
N-[2-(4-bromocinnamylamino)ethyl]isoquinoline-5-sulfonamide(2+) (CHEBI:131489) is a ammonium ion derivative (CHEBI:35274)
N-acetyl-β-D-glucosaminyl-(1→4)-D-glucosaminium(1+) (CHEBI:59910) is a ammonium ion derivative (CHEBI:35274)
N-acetylcadaverine(1+) (CHEBI:134408) is a ammonium ion derivative (CHEBI:35274)
N-acetylputrescinium (CHEBI:58263) is a ammonium ion derivative (CHEBI:35274)
N-allyl-1-phenyl-2,3,4,5-tetrahydro-3-benzazepinium-7,8-diol(1+) (CHEBI:63987) is a ammonium ion derivative (CHEBI:35274)
N-allyl-6-chloro-1-(3-methylphenyl)-2,3,4,5-tetrahydro-3-benzazepinium-7,8-diol(1+) (CHEBI:64003) is a ammonium ion derivative (CHEBI:35274)
N-caffeoylputrescinium(1+) (CHEBI:58138) is a ammonium ion derivative (CHEBI:35274)
N-carbamoylputrescinium(1+) (CHEBI:58318) is a ammonium ion derivative (CHEBI:35274)
N-methyl-6-chloro-1-(3-methylphenyl)-2,3,4,5-tetrahydro-3-benzazepinium-7,8-diol(1+) (CHEBI:64000) is a ammonium ion derivative (CHEBI:35274)
N-methylphenylethanolaminium (CHEBI:57946) is a ammonium ion derivative (CHEBI:35274)
N-methylputrescinium(2+) (CHEBI:58039) is a ammonium ion derivative (CHEBI:35274)
N-methyltyraminium (CHEBI:58155) is a ammonium ion derivative (CHEBI:35274)
N-monoacetylalkane-α,ω-diamine(1+) (CHEBI:70988) is a ammonium ion derivative (CHEBI:35274)
Nα-acetyl-L-lysine methyl ester(1+) (CHEBI:64854) is a ammonium ion derivative (CHEBI:35274)
Nτ-methylhistaminium (CHEBI:58600) is a ammonium ion derivative (CHEBI:35274)
N1,N12-diacetylsperminium(2+) (CHEBI:58550) is a ammonium ion derivative (CHEBI:35274)
N1,N8-bis(coumaroyl)spermidine(1+) (CHEBI:85007) is a ammonium ion derivative (CHEBI:35274)
N1,N8-bis(sinapoyl)-spermidine(1+) (CHEBI:85006) is a ammonium ion derivative (CHEBI:35274)
N1-acetylspermidinium(2+) (CHEBI:58324) is a ammonium ion derivative (CHEBI:35274)
N1-acetylsperminium(3+) (CHEBI:58101) is a ammonium ion derivative (CHEBI:35274)
N2'-acetylgentamycin C1a(4+) (CHEBI:58552) is a ammonium ion derivative (CHEBI:35274)
N3'-acetyl-2-deoxystreptamine antibiotic(1+) (CHEBI:57921) is a ammonium ion derivative (CHEBI:35274)
N3'-acetylgentamycin C(4+) (CHEBI:75617) is a ammonium ion derivative (CHEBI:35274)
N4-aminopropylspermidine(4+) (CHEBI:82770) is a ammonium ion derivative (CHEBI:35274)
N4-aminopropylspermine(5+) (CHEBI:82772) is a ammonium ion derivative (CHEBI:35274)
N6'-acetylkanamycin B(4+) (CHEBI:58390) is a ammonium ion derivative (CHEBI:35274)
N8-acetylspermidinium(2+) (CHEBI:58535) is a ammonium ion derivative (CHEBI:35274)
O-acetyl-15α-stemmadenine(1+) (CHEBI:142673) is a ammonium ion derivative (CHEBI:35274)
O-demethylpuromycin(1+) (CHEBI:58037) is a ammonium ion derivative (CHEBI:35274)
S-acetylcysteaminium (CHEBI:58295) is a ammonium ion derivative (CHEBI:35274)
S-adenosylmethioninaminium (CHEBI:57443) is a ammonium ion derivative (CHEBI:35274)
sym-homospermidinium(3+) (CHEBI:57811) is a ammonium ion derivative (CHEBI:35274)
tert-butylammonium (CHEBI:224366) is a ammonium ion derivative (CHEBI:35274)
D-2-ammoniohexano-6-lactam (CHEBI:58609) is a ammonium ion derivative (CHEBI:35274)
D-cycloserine(1+) (CHEBI:75929) is a ammonium ion derivative (CHEBI:35274)
D-glucosylsphingosine(1+) (CHEBI:62495) is a ammonium ion derivative (CHEBI:35274)
D-ornithinium(1+) (CHEBI:57668) is a ammonium ion derivative (CHEBI:35274)
D-synephrine(1+) (CHEBI:63694) is a ammonium ion derivative (CHEBI:35274)
L-2-ammoniohexano-6-lactam (CHEBI:58113) is a ammonium ion derivative (CHEBI:35274)
L-alaninamide(1+) (CHEBI:74169) is a ammonium ion derivative (CHEBI:35274)
L-histidinal(1+) (CHEBI:64802) is a ammonium ion derivative (CHEBI:35274)
L-histidinol(1+) (CHEBI:57699) is a ammonium ion derivative (CHEBI:35274)
L-homoserine lactone(1+) (CHEBI:58633) is a ammonium ion derivative (CHEBI:35274)
L-tryptophanamide(1+) (CHEBI:57803) is a ammonium ion derivative (CHEBI:35274)
acarbose(1+) (CHEBI:84363) is a ammonium ion derivative (CHEBI:35274)
acebutolol(1+) (CHEBI:62101) is a ammonium ion derivative (CHEBI:35274)
acridine half-mustard(2+) (CHEBI:132981) is a ammonium ion derivative (CHEBI:35274)
adamantan-1-aminium (CHEBI:48320) is a ammonium ion derivative (CHEBI:35274)
agroclavine(1+) (CHEBI:65042) is a ammonium ion derivative (CHEBI:35274)
ajmalicine(1+) (CHEBI:142527) is a ammonium ion derivative (CHEBI:35274)
ajmalinium (CHEBI:58567) is a ammonium ion derivative (CHEBI:35274)
akuammicine(1+) (CHEBI:142754) is a ammonium ion derivative (CHEBI:35274)
alectinib(1+) (CHEBI:90937) is a ammonium ion derivative (CHEBI:35274)
alkane-α,ω-diammonium(2+) (CHEBI:70977) is a ammonium ion derivative (CHEBI:35274)
alogliptin(1+) (CHEBI:72326) is a ammonium ion derivative (CHEBI:35274)
alverine(1+) (CHEBI:64320) is a ammonium ion derivative (CHEBI:35274)
alvocidib(1+) (CHEBI:90997) is a ammonium ion derivative (CHEBI:35274)
amikacin(4+) (CHEBI:84739) is a ammonium ion derivative (CHEBI:35274)
aminopropylcadaverine(3+) (CHEBI:64858) is a ammonium ion derivative (CHEBI:35274)
ammonioacetaldehyde (CHEBI:58213) is a ammonium ion derivative (CHEBI:35274)
ammonioacetone (CHEBI:58320) is a ammonium ion derivative (CHEBI:35274)
ammoniodiacetate (CHEBI:62745) is a ammonium ion derivative (CHEBI:35274)
amodiaquine(1+) (CHEBI:131327) is a ammonium ion derivative (CHEBI:35274)
amorolfine(1+) (CHEBI:86380) is a ammonium ion derivative (CHEBI:35274)
anthracycline cation (CHEBI:64678) is a ammonium ion derivative (CHEBI:35274)
arformoterol(1+) (CHEBI:63107) is a ammonium ion derivative (CHEBI:35274)
argemonine(1+) (CHEBI:76922) is a ammonium ion derivative (CHEBI:35274)
atropinium (CHEBI:57858) is a ammonium ion derivative (CHEBI:35274)
AZD1979(1+) (CHEBI:138980) is a ammonium ion derivative (CHEBI:35274)
bedaquiline(2+) (CHEBI:72706) is a ammonium ion derivative (CHEBI:35274)
benazepril(1+) (CHEBI:88201) is a ammonium ion derivative (CHEBI:35274)
benethamine(1+) (CHEBI:52149) is a ammonium ion derivative (CHEBI:35274)
benserazide(1+) (CHEBI:64190) is a ammonium ion derivative (CHEBI:35274)
benzathine(1+) (CHEBI:51346) is a ammonium ion derivative (CHEBI:35274)
benzathine(2+) (CHEBI:51345) is a ammonium ion derivative (CHEBI:35274)
benzydamine(1+) (CHEBI:134500) is a ammonium ion derivative (CHEBI:35274)
benzyl cetraxate(1+) (CHEBI:57790) is a ammonium ion derivative (CHEBI:35274)
benzylaminium (CHEBI:225238) is a ammonium ion derivative (CHEBI:35274)
berbamuninium(2+) (CHEBI:57894) is a ammonium ion derivative (CHEBI:35274)
BGT226(1+) (CHEBI:71966) is a ammonium ion derivative (CHEBI:35274)
bis(3-azaniumylpropyl)azanium (CHEBI:57920) is a ammonium ion derivative (CHEBI:35274)
bromhexine(1+) (CHEBI:77040) is a ammonium ion derivative (CHEBI:35274)
buclizine(2+) (CHEBI:61192) is a ammonium ion derivative (CHEBI:35274)
bulbocapnine(1+) (CHEBI:134215) is a ammonium ion derivative (CHEBI:35274)
buspirone(1+) (CHEBI:132102) is a ammonium ion derivative (CHEBI:35274)
butamben(1+) (CHEBI:86302) is a ammonium ion derivative (CHEBI:35274)
butirosin B(4+) (CHEBI:65085) is a ammonium ion derivative (CHEBI:35274)
caldopentamine(4+) (CHEBI:82769) is a ammonium ion derivative (CHEBI:35274)
caldopentamine(5+) (CHEBI:82768) is a ammonium ion derivative (CHEBI:35274)
cariprazine(1+) (CHEBI:90934) is a ammonium ion derivative (CHEBI:35274)
carmoxirole(1+) (CHEBI:64201) is a ammonium ion derivative (CHEBI:35274)
carteolol(1+) (CHEBI:61202) is a ammonium ion derivative (CHEBI:35274)
catharanthine(1+) (CHEBI:142675) is a ammonium ion derivative (CHEBI:35274)
cationic chitosan (CHEBI:57704) is a ammonium ion derivative (CHEBI:35274)
cationic sphingoid (CHEBI:83876) is a ammonium ion derivative (CHEBI:35274)
CGP 78608(1+) (CHEBI:64066) is a ammonium ion derivative (CHEBI:35274)
chanoclavine-I(1+) (CHEBI:72949) is a ammonium ion derivative (CHEBI:35274)
chloroorienticin B(1+) (CHEBI:75963) is a ammonium ion derivative (CHEBI:35274)
cinanserin(1+) (CHEBI:147283) is a ammonium ion derivative (CHEBI:35274)
clenbuterol(1+) (CHEBI:61153) is a ammonium ion derivative (CHEBI:35274)
clomipramine(1+) (CHEBI:64209) is a ammonium ion derivative (CHEBI:35274)
cobimetinib(1+) (CHEBI:90854) is a ammonium ion derivative (CHEBI:35274)
cocaine(1+) (CHEBI:60056) is a ammonium ion derivative (CHEBI:35274)
codeine(1+) (CHEBI:57871) is a ammonium ion derivative (CHEBI:35274)
codeinone(1+) (CHEBI:58473) is a ammonium ion derivative (CHEBI:35274)
cyclohexylammonium (CHEBI:42939) is a ammonium ion derivative (CHEBI:35274)
cysteaminium (CHEBI:58029) is a ammonium ion derivative (CHEBI:35274)
deacetylisoipecoside(1+) (CHEBI:58091) is a ammonium ion derivative (CHEBI:35274)
deaminohydroxyblasticidin S(1+) (CHEBI:57697) is a ammonium ion derivative (CHEBI:35274)
demethyllactenocin(1+) (CHEBI:76810) is a ammonium ion derivative (CHEBI:35274)
demethylmacrocin(1+) (CHEBI:76819) is a ammonium ion derivative (CHEBI:35274)
dexverapamil(1+) (CHEBI:77737) is a ammonium ion derivative (CHEBI:35274)
dihydrochanoclavine-I aldehyde(1+) (CHEBI:65032) is a ammonium ion derivative (CHEBI:35274)
diltiazem(1+) (CHEBI:82812) is a ammonium ion derivative (CHEBI:35274)
dipivefrin(1+) (CHEBI:73714) is a ammonium ion derivative (CHEBI:35274)
dopaminium(1+) (CHEBI:59905) is a ammonium ion derivative (CHEBI:35274)
E-3810(1+) (CHEBI:65208) is a ammonium ion derivative (CHEBI:35274)
ecgoninium methyl ester(1+) (CHEBI:59908) is a ammonium ion derivative (CHEBI:35274)
ecgononium methyl ester(1+) (CHEBI:66941) is a ammonium ion derivative (CHEBI:35274)
eletriptan(1+) (CHEBI:61177) is a ammonium ion derivative (CHEBI:35274)
eliglustat(1+) (CHEBI:83355) is a ammonium ion derivative (CHEBI:35274)
emetine(2+) (CHEBI:149548) is a ammonium ion derivative (CHEBI:35274)
epoxyqueuine(1+) (CHEBI:77675) is a ammonium ion derivative (CHEBI:35274)
eprazinone(2+) (CHEBI:83323) is a ammonium ion derivative (CHEBI:35274)
eribulin(1+) (CHEBI:70711) is a ammonium ion derivative (CHEBI:35274)
erythromycin cation (CHEBI:64290) is a ammonium ion derivative (CHEBI:35274)
ethidium homodimer tetracation (CHEBI:52843) is a ammonium ion derivative (CHEBI:35274)
ethylaminium (CHEBI:566789) is a ammonium ion derivative (CHEBI:35274)
festuclavine(1+) (CHEBI:65045) is a ammonium ion derivative (CHEBI:35274)
fingolimod(1+) (CHEBI:63113) is a ammonium ion derivative (CHEBI:35274)
flecainide(1+) (CHEBI:76033) is a ammonium ion derivative (CHEBI:35274)
FR901469(1+) (CHEBI:68659) is a ammonium ion derivative (CHEBI:35274)
framycetin(6+) (CHEBI:87835) is a ammonium ion derivative (CHEBI:35274)
fumigaclavine A(1+) (CHEBI:67145) is a ammonium ion derivative (CHEBI:35274)
fumigaclavine B(1+) (CHEBI:67146) is a ammonium ion derivative (CHEBI:35274)
fumigaclavine C(1+) (CHEBI:67147) is a ammonium ion derivative (CHEBI:35274)
fumonisin B1(3-) (CHEBI:62554) is a ammonium ion derivative (CHEBI:35274)
gentamicin C(5+) (CHEBI:75616) is a ammonium ion derivative (CHEBI:35274)
gentamycin C1a(5+) (CHEBI:58530) is a ammonium ion derivative (CHEBI:35274)
gentamycin(2+) (CHEBI:90218) is a ammonium ion derivative (CHEBI:35274)
gevotroline(1+) (CHEBI:142392) is a ammonium ion derivative (CHEBI:35274)
GGTI-2133 free base(1+) (CHEBI:101333) is a ammonium ion derivative (CHEBI:35274)
glutathionylspermidinium(2+) (CHEBI:57835) is a ammonium ion derivative (CHEBI:35274)
GR 127935(1+) (CHEBI:64113) is a ammonium ion derivative (CHEBI:35274)
gramine(1+) (CHEBI:136516) is a ammonium ion derivative (CHEBI:35274)
hörhammericine(1+) (CHEBI:144375) is a ammonium ion derivative (CHEBI:35274)
histaminium (CHEBI:58432) is a ammonium ion derivative (CHEBI:35274)
homoserinium lactone (CHEBI:58093) is a ammonium ion derivative (CHEBI:35274)
hycanthone(1+) (CHEBI:67141) is a ammonium ion derivative (CHEBI:35274)
hydrabamine(1+) (CHEBI:52170) is a ammonium ion derivative (CHEBI:35274)
hydrabamine(2+) (CHEBI:52171) is a ammonium ion derivative (CHEBI:35274)
hygromycin B(3+) (CHEBI:57971) is a ammonium ion derivative (CHEBI:35274)
indacaterol(1+) (CHEBI:68574) is a ammonium ion derivative (CHEBI:35274)
indole alkaloid cation (CHEBI:60521) is a ammonium ion derivative (CHEBI:35274)
irinotecan(1+) (CHEBI:90895) is a ammonium ion derivative (CHEBI:35274)
isopropylaminium (CHEBI:57492) is a ammonium ion derivative (CHEBI:35274)
ivabradine(1+) (CHEBI:85972) is a ammonium ion derivative (CHEBI:35274)
kanamycin A 3'-phosphate(2+) (CHEBI:57909) is a ammonium ion derivative (CHEBI:35274)
kanamycin B(5+) (CHEBI:58549) is a ammonium ion derivative (CHEBI:35274)
kanamycin C(4+) (CHEBI:72755) is a ammonium ion derivative (CHEBI:35274)
kanamycin D(3+) (CHEBI:72947) is a ammonium ion derivative (CHEBI:35274)
kanamycin X(3+) (CHEBI:72756) is a ammonium ion derivative (CHEBI:35274)
ketotifen(1+) (CHEBI:140417) is a ammonium ion derivative (CHEBI:35274)
laudanine(1+) (CHEBI:76102) is a ammonium ion derivative (CHEBI:35274)
legionaminate(1+) (CHEBI:68668) is a ammonium ion derivative (CHEBI:35274)
levobunolol(1+) (CHEBI:72567) is a ammonium ion derivative (CHEBI:35274)
lochnericine(1+) (CHEBI:144374) is a ammonium ion derivative (CHEBI:35274)
lomitapide(1+) (CHEBI:72302) is a ammonium ion derivative (CHEBI:35274)
loperamide(1+) (CHEBI:86969) is a ammonium ion derivative (CHEBI:35274)
lorcaserin(1+) (CHEBI:65351) is a ammonium ion derivative (CHEBI:35274)
lupanine(1+) (CHEBI:64261) is a ammonium ion derivative (CHEBI:35274)
LY-310762(1+) (CHEBI:140938) is a ammonium ion derivative (CHEBI:35274)
macrocin(1+) (CHEBI:76820) is a ammonium ion derivative (CHEBI:35274)
memantinium(1+) (CHEBI:64325) is a ammonium ion derivative (CHEBI:35274)
methiothepin(2+) (CHEBI:64204) is a ammonium ion derivative (CHEBI:35274)
methoctramine(4+) (CHEBI:73453) is a ammonium ion derivative (CHEBI:35274)
methylammonium (CHEBI:59338) is a ammonium ion derivative (CHEBI:35274)
methylated primary amine(1+) (CHEBI:131823) is a ammonium ion derivative (CHEBI:35274)
methylphenidate(1+) (CHEBI:51856) is a ammonium ion derivative (CHEBI:35274)
methymycin(1+) (CHEBI:77352) is a ammonium ion derivative (CHEBI:35274)
metoclopramide(1+) (CHEBI:61170) is a ammonium ion derivative (CHEBI:35274)
metoclopramide(2+) (CHEBI:61172) is a ammonium ion derivative (CHEBI:35274)
midodrine(1+) (CHEBI:73243) is a ammonium ion derivative (CHEBI:35274)
morphine(1+) (CHEBI:58097) is a ammonium ion derivative (CHEBI:35274)
morphiniumone(1+) (CHEBI:57728) is a ammonium ion derivative (CHEBI:35274)
moxifloxacinium(1+) (CHEBI:63699) is a ammonium ion derivative (CHEBI:35274)
mycinamicin cation (CHEBI:63309) is a ammonium ion derivative (CHEBI:35274)
naloxone(1+) (CHEBI:90756) is a ammonium ion derivative (CHEBI:35274)
naltrexone(1+) (CHEBI:134688) is a ammonium ion derivative (CHEBI:35274)
NAN 190(1+) (CHEBI:64132) is a ammonium ion derivative (CHEBI:35274)
narbomycin(1+) (CHEBI:76801) is a ammonium ion derivative (CHEBI:35274)
neamine(4+) (CHEBI:65076) is a ammonium ion derivative (CHEBI:35274)
nebramycin 5'(5+) (CHEBI:73679) is a ammonium ion derivative (CHEBI:35274)
nelfinavir(1+) (CHEBI:78767) is a ammonium ion derivative (CHEBI:35274)
neomethymycin(1+) (CHEBI:77353) is a ammonium ion derivative (CHEBI:35274)
neomycin C(6+) (CHEBI:65077) is a ammonium ion derivative (CHEBI:35274)
neopikromycin(1+) (CHEBI:77350) is a ammonium ion derivative (CHEBI:35274)
neopinone(1+) (CHEBI:59950) is a ammonium ion derivative (CHEBI:35274)
noradrenaline(1+) (CHEBI:166902) is a ammonium ion derivative (CHEBI:35274)
norajmaline(1+) (CHEBI:77618) is a ammonium ion derivative (CHEBI:35274)
norbelladine(1+) (CHEBI:134001) is a ammonium ion derivative (CHEBI:35274)
nororientalinium(1+) (CHEBI:57996) is a ammonium ion derivative (CHEBI:35274)
novamethymycin(1+) (CHEBI:77354) is a ammonium ion derivative (CHEBI:35274)
novapikromycin(1+) (CHEBI:77351) is a ammonium ion derivative (CHEBI:35274)
octopaminium (CHEBI:58025) is a ammonium ion derivative (CHEBI:35274)
oleandomycin(1+) (CHEBI:57933) is a ammonium ion derivative (CHEBI:35274)
olodaterol(1+) (CHEBI:83312) is a ammonium ion derivative (CHEBI:35274)
osimertinib(1+) (CHEBI:90949) is a ammonium ion derivative (CHEBI:35274)
oxycodone(1+) (CHEBI:134686) is a ammonium ion derivative (CHEBI:35274)
palonosetron(1+) (CHEBI:85163) is a ammonium ion derivative (CHEBI:35274)
panobinostat(1+) (CHEBI:85992) is a ammonium ion derivative (CHEBI:35274)
paromamine(3+) (CHEBI:65015) is a ammonium ion derivative (CHEBI:35274)
paroxetinium(1+) (CHEBI:64197) is a ammonium ion derivative (CHEBI:35274)
pavine(1+) (CHEBI:76921) is a ammonium ion derivative (CHEBI:35274)
PD-153035(1+) (CHEBI:91077) is a ammonium ion derivative (CHEBI:35274)
pergolide(1+) (CHEBI:63706) is a ammonium ion derivative (CHEBI:35274)
pethidine(1+) (CHEBI:149471) is a ammonium ion derivative (CHEBI:35274)
PF-670462 free base(2+) (CHEBI:87284) is a ammonium ion derivative (CHEBI:35274)
phenazopyridine(1+) (CHEBI:71420) is a ammonium ion derivative (CHEBI:35274)
phenylephrine(1+) (CHEBI:132294) is a ammonium ion derivative (CHEBI:35274)
phenylethanolaminium (CHEBI:57741) is a ammonium ion derivative (CHEBI:35274)
pikromycin(1+) (CHEBI:76800) is a ammonium ion derivative (CHEBI:35274)
pipamperone(2+) (CHEBI:78943) is a ammonium ion derivative (CHEBI:35274)
piperidinium ion (CHEBI:48633) is a ammonium ion derivative (CHEBI:35274)
pizotifen(1+) (CHEBI:50318) is a ammonium ion derivative (CHEBI:35274)
pramipexole(2+) (CHEBI:63218) is a ammonium ion derivative (CHEBI:35274)
primary ammonium ion (CHEBI:65296) is a ammonium ion derivative (CHEBI:35274)
promethazine(1+) (CHEBI:61214) is a ammonium ion derivative (CHEBI:35274)
propafenone(1+) (CHEBI:63650) is a ammonium ion derivative (CHEBI:35274)
propan-1-aminium (CHEBI:566825) is a ammonium ion derivative (CHEBI:35274)
pseudoephedrine(1+) (CHEBI:132296) is a ammonium ion derivative (CHEBI:35274)
pseudooxynicotinium(1+) (CHEBI:66878) is a ammonium ion derivative (CHEBI:35274)
pseudotropinium (CHEBI:57493) is a ammonium ion derivative (CHEBI:35274)
psychosine(1+) (CHEBI:57934) is a ammonium ion derivative (CHEBI:35274)
pyridoxaminium(1+) (CHEBI:57761) is a ammonium ion derivative (CHEBI:35274)
quaternary ammonium ion (CHEBI:35267) is a ammonium ion derivative (CHEBI:35274)
queuine(1+) (CHEBI:77674) is a ammonium ion derivative (CHEBI:35274)
quinapril(1+) (CHEBI:141523) is a ammonium ion derivative (CHEBI:35274)
raloxifene(1+) (CHEBI:90191) is a ammonium ion derivative (CHEBI:35274)
rhodomycin D(1+) (CHEBI:77073) is a ammonium ion derivative (CHEBI:35274)
ribostamycin(4+) (CHEBI:65028) is a ammonium ion derivative (CHEBI:35274)
rivastigmine(1+) (CHEBI:64363) is a ammonium ion derivative (CHEBI:35274)
Ro 48-8071(1+) (CHEBI:101224) is a ammonium ion derivative (CHEBI:35274)
rolapitant(1+) (CHEBI:90913) is a ammonium ion derivative (CHEBI:35274)
RS 39604(1+) (CHEBI:64082) is a ammonium ion derivative (CHEBI:35274)
rucaparib(1+) (CHEBI:134695) is a ammonium ion derivative (CHEBI:35274)
salutaridinium(1+) (CHEBI:58061) is a ammonium ion derivative (CHEBI:35274)
SB 224289(1+) (CHEBI:64071) is a ammonium ion derivative (CHEBI:35274)
scopolamine(1+) (CHEBI:61269) is a ammonium ion derivative (CHEBI:35274)
secondary ammonium ion (CHEBI:137419) is a ammonium ion derivative (CHEBI:35274)
senecionine(1+) (CHEBI:77617) is a ammonium ion derivative (CHEBI:35274)
serotonin(1+) (CHEBI:350546) is a ammonium ion derivative (CHEBI:35274)
sertraline(1+) (CHEBI:64214) is a ammonium ion derivative (CHEBI:35274)
SIS3 free base(1+) (CHEBI:87591) is a ammonium ion derivative (CHEBI:35274)
sotalol(1+) (CHEBI:63647) is a ammonium ion derivative (CHEBI:35274)
spectinomycin(2+) (CHEBI:77315) is a ammonium ion derivative (CHEBI:35274)
spermidine(3+) (CHEBI:57834) is a ammonium ion derivative (CHEBI:35274)
spermine(4+) (CHEBI:45725) is a ammonium ion derivative (CHEBI:35274)
sphingosine-1-phosphocholine(1+) (CHEBI:58906) is a ammonium ion derivative (CHEBI:35274)
staurosporinium (CHEBI:57491) is a ammonium ion derivative (CHEBI:35274)
strictosidine aglycone(1+) (CHEBI:58012) is a ammonium ion derivative (CHEBI:35274)
sumatriptan(1+) (CHEBI:64364) is a ammonium ion derivative (CHEBI:35274)
synephrinium (CHEBI:58606) is a ammonium ion derivative (CHEBI:35274)
tandospirone(1+) (CHEBI:145674) is a ammonium ion derivative (CHEBI:35274)
tenofovir alafenamide(1+) (CHEBI:90927) is a ammonium ion derivative (CHEBI:35274)
terbinafine(1+) (CHEBI:77615) is a ammonium ion derivative (CHEBI:35274)
tetradecaphytosphingosine(1+) (CHEBI:82879) is a ammonium ion derivative (CHEBI:35274)
tetrahydroalstonine(1+) (CHEBI:142526) is a ammonium ion derivative (CHEBI:35274)
thebaine(1+) (CHEBI:59953) is a ammonium ion derivative (CHEBI:35274)
thermosperminium(4+) (CHEBI:59903) is a ammonium ion derivative (CHEBI:35274)
thiocyclam(1+) (CHEBI:133552) is a ammonium ion derivative (CHEBI:35274)
tiagabine(1+) (CHEBI:85387) is a ammonium ion derivative (CHEBI:35274)
tigecycline(1+) (CHEBI:142708) is a ammonium ion derivative (CHEBI:35274)
tilorone(2+) (CHEBI:147355) is a ammonium ion derivative (CHEBI:35274)
tobramycin(5+) (CHEBI:73678) is a ammonium ion derivative (CHEBI:35274)
tricaine(1+) (CHEBI:131337) is a ammonium ion derivative (CHEBI:35274)
triethanolammonium (CHEBI:132755) is a ammonium ion derivative (CHEBI:35274)
triethylammonium ion (CHEBI:45791) is a ammonium ion derivative (CHEBI:35274)
trimethylammonium (CHEBI:58389) is a ammonium ion derivative (CHEBI:35274)
triprolidine(1+) (CHEBI:84117) is a ammonium ion derivative (CHEBI:35274)
tropinium (CHEBI:57554) is a ammonium ion derivative (CHEBI:35274)
tropiniumone (CHEBI:57851) is a ammonium ion derivative (CHEBI:35274)
tropisetron(1+) (CHEBI:77571) is a ammonium ion derivative (CHEBI:35274)
trovafloxacin(1+) (CHEBI:77569) is a ammonium ion derivative (CHEBI:35274)
trypanothione disulfide(1+) (CHEBI:58661) is a ammonium ion derivative (CHEBI:35274)
tryptaminium (CHEBI:57887) is a ammonium ion derivative (CHEBI:35274)
tylosin(1+) (CHEBI:77047) is a ammonium ion derivative (CHEBI:35274)
tyraminium (CHEBI:327995) is a ammonium ion derivative (CHEBI:35274)
validamycin A(1+) (CHEBI:90869) is a ammonium ion derivative (CHEBI:35274)
validoxylamine A(1+) (CHEBI:111505) is a ammonium ion derivative (CHEBI:35274)
vanoxerine(2+) (CHEBI:64087) is a ammonium ion derivative (CHEBI:35274)
varenicline(1+) (CHEBI:84508) is a ammonium ion derivative (CHEBI:35274)
vilanterol(1+) (CHEBI:75039) is a ammonium ion derivative (CHEBI:35274)
vinca alkaloid cation (CHEBI:60082) is a ammonium ion derivative (CHEBI:35274)
vortioxetine(1+) (CHEBI:76017) is a ammonium ion derivative (CHEBI:35274)
ZM 323881(1+) (CHEBI:91187) is a ammonium ion derivative (CHEBI:35274)
Synonyms Sources
ammonium ion derivatives ChEBI
azanium ion derivative ChEBI
azanium ion derivatives ChEBI
Last Modified
27 April 2020