|
(2Z,5Z,8Z,11Z,14Z,17Z)-icosa-2,5,8,11,14,17-hexaenoic acid |
|
CHEBI:83031 |
|
(2Z,5Z,8Z,11Z,14Z,17Z)-icosa-2,5,8,11,14,17-hexaenoic acid |
|
A polyunsaturated fatty acid that is icosanoic acid having unsaturation at positions 2, 5, 8, 11, 14 and 17. It has been found in Daphnia galeata. |
|
This entity has been manually annotated by the ChEBI Team.
|
|
|
|
Molfile
XML
SDF
|
|
|
|
InChI=1S/C20H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17H2,1H3,(H,21,22)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
GGLBNABMJBBTJP-KUBAVDMBSA-N |
CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/C\C=C/C(O)=O |
|
Daphnia galeata
(NCBI:txid27404)
|
See:
Is the fatty acid composition of Daphnia galeata determined by the fatty acid composition of the ingested diet?Weers P.M.M., Siewertsen K., and Gulati R.D.Freshwater Biology (1997), 38, 731-738
|
Bronsted acid
A molecular entity capable of donating a hydron to an acceptor (Bronsted base).
(via oxoacid )
|
|
Daphnia galeata metabolite
A Daphnia metabolite produced by the species Daphnia galeata.
|
|
View more via ChEBI Ontology
Outgoing
|
(2Z,5Z,8Z,11Z,14Z,17Z)-icosa-2,5,8,11,14,17-hexaenoic acid
(CHEBI:83031)
has role
Daphnia galeata metabolite
(CHEBI:83038)
(2Z,5Z,8Z,11Z,14Z,17Z)-icosa-2,5,8,11,14,17-hexaenoic acid
(CHEBI:83031)
is a
long-chain fatty acid
(CHEBI:15904)
(2Z,5Z,8Z,11Z,14Z,17Z)-icosa-2,5,8,11,14,17-hexaenoic acid
(CHEBI:83031)
is a
polyunsaturated fatty acid
(CHEBI:26208)
(2Z,5Z,8Z,11Z,14Z,17Z)-icosa-2,5,8,11,14,17-hexaenoic acid
(CHEBI:83031)
is a
straight-chain fatty acid
(CHEBI:59202)
|
|
(2Z,5Z,8Z,11Z,14Z,17Z)-icosa-2,5,8,11,14,17-hexaenoic acid
|
|