Ketcher 05262116382D 1 1.00000 0.00000 0 19 20 0 0 0 999 V2000 11.5242 -22.2526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3903 -22.7526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6582 -22.7527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3903 -23.7527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6582 -23.7527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5243 -24.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2563 -24.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1223 -23.7527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.2563 -25.2527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5242 -21.2526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.7922 -22.2528 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.9262 -22.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9262 -23.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0601 -22.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0601 -24.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1941 -22.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1941 -23.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9883 -24.2526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8543 -23.7526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 1 3 2 0 0 0 2 4 2 0 0 0 3 5 1 0 0 0 4 6 1 0 0 0 5 6 2 0 0 0 4 7 1 0 0 0 7 8 1 0 0 0 7 9 2 0 0 0 1 10 1 0 0 0 3 11 1 0 0 0 11 12 1 0 0 0 12 13 1 0 0 0 12 14 1 0 0 0 13 15 1 0 0 0 14 16 1 0 0 0 15 17 1 0 0 0 16 17 1 0 0 0 8 18 1 0 0 0 18 19 1 0 0 0 M END > CHEBI:173086 > ferrostatin-1 > An ethyl ester resulting from the formal condensation of the carboxy group of 3-amino-4-(cyclohexylamino)benzoic acid with ethanol. It is a potent inhibitor of ferroptosis, a distinct non-apoptotic form of cell death caused by lipid peroxidation. It is also a radical-trapping antioxidant and has the ability to reduce the accumulation of lipid peroxides and chain-carrying peroxyl radicals. > 3 > ferrrostatin 1; Fer-1; 3-amino-4-cyclohexylaminobenzoic acid ethyl ester > ethyl 3-amino-4-(cyclohexylamino)benzoate > C15H22N2O2 > 262.353 > 262.16813 > 0 > CCOC(=O)C1=CC(N)=C(NC2CCCCC2)C=C1 > InChI=1S/C15H22N2O2/c1-2-19-15(18)11-8-9-14(13(16)10-11)17-12-6-4-3-5-7-12/h8-10,12,17H,2-7,16H2,1H3 > UJHBVMHOBZBWMX-UHFFFAOYSA-N > 347174-05-4 > 22632970; 26385697; 26410073; 26696014; 28250973; 28386601; 28783875; 30354101; 31531196; 31571665; 31574461; 31864943; 32161620; 32984038; 33109343; 33126055; 33278745; 33464146; 33631670; 33669598; 33991524 $$$$