ChEBI 13 12 0 0 0 0 0 0 0 0 1 V2000 7.1359 -5.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1359 -5.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8496 -4.6226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4221 -4.6226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8496 -6.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5634 -5.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4221 -3.7984 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7048 -5.0329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5634 -5.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8496 -7.0984 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2772 -4.6226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2772 -6.2708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5565 -6.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 3 2 0 0 0 0 1 4 1 0 0 0 0 2 5 2 0 0 0 0 3 6 1 0 0 0 0 4 7 1 0 0 0 0 4 8 2 0 0 0 0 5 9 1 0 0 0 0 5 10 1 0 0 0 0 6 11 2 0 0 0 0 9 12 1 0 0 0 0 9 13 2 0 0 0 0 M END > CHEBI:18046 > 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde > A carboxy-2-hydroxymuconate semialdehyde having the carboxy group at the 4-position and the aldehyde functijon at the 6-position. > 3 > CHEBI:1793; CHEBI:11968; CHEBI:20325; CHEBI:11966 > 4-Carboxy-2-hydroxymuconate semialdehyde; 4-Carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde; 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde; 2-hydroxy-4-carboxymuconate semialdehyde > (2E,4E)-2-hydroxy-4-(2-oxoethylidene)pent-2-enedioic acid > C7H6O6 > 186.11894 > 186.01644 > 0 > OC(=O)C(\O)=C/C(=C\C=O)C(O)=O > InChI=1S/C7H6O6/c8-2-1-4(6(10)11)3-5(9)7(12)13/h1-3,9H,(H,10,11)(H,12,13)/b4-1+,5-3+ > YOMOLPRSDGXHCY-CLLRDSTBSA-N > 28345-81-5 > C04484 $$$$