Marvin 01141314402D 14 15 0 0 0 0 999 V2000 10.1180 0.0666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8293 0.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8293 1.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1180 1.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4068 0.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4022 1.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6126 1.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1292 0.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6200 0.2142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3536 2.3373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3051 0.8772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3698 -0.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5646 -0.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3143 -1.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 6 7 2 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 5 1 0 0 0 0 3 4 2 0 0 0 0 7 10 1 0 0 0 0 5 6 1 0 0 0 0 8 11 2 0 0 0 0 9 12 2 0 0 0 0 6 4 1 0 0 0 0 12 13 1 0 0 0 0 5 1 1 0 0 0 0 13 14 2 0 0 0 0 M END > CHEBI:65801 > 5-hydroxy-7-prop-2-en-(Z)-ylidene-7,7a-dihydro- 2H-cyclopenta[b]pyran-6-one > An organic heterobicyclic compound that is 7,7a-dihydrocyclopenta[b]pyran-6(2H)-one substituted by a hydroxy group at position 5 and a prop-2-en-1-ylidene group at position 7 (the Z isomer). Isolated from the sponge Ulosa and ascidian Diplosoma virens, it exhibits antimicrobial activity and toxicity against HCT116 cells (human colorectal cancer cells) by triggering apoptotic cell death. > 3 > Diplosoma ylidene 2 > (7Z)-5-hydroxy-7-(prop-2-en-1-ylidene)-7,7a-dihydrocyclopenta[b]pyran-6(2H)-one > C11H10O3 > 190.19530 > 190.06299 > 0 > OC1=C2C=CCOC2\C(=C\C=C)C1=O > InChI=1S/C11H10O3/c1-2-4-7-9(12)10(13)8-5-3-6-14-11(7)8/h2-5,11,13H,1,6H2/b7-4+ > CCVQPAZRNPBPPA-QPJJXVBHSA-N > 15800347 > 18463568 $$$$