Marvin 08021211152D 12 12 0 0 0 0 999 V2000 1.9316 -0.1444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2642 -0.6294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5191 -1.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3441 -1.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5990 -0.6294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3959 -0.4159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0917 1.0116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4242 0.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5105 -0.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3726 0.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5862 1.5371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9560 0.1568 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 2 3 1 0 0 0 0 3 4 2 0 0 0 0 4 5 1 0 0 0 0 1 5 1 0 0 0 0 5 6 2 0 0 0 0 2 1 1 0 0 0 0 9 2 2 0 0 0 0 7 8 2 0 0 0 0 8 9 1 0 0 0 0 8 10 1 0 0 0 0 10 11 2 0 0 0 0 10 12 1 0 0 0 0 M CHG 1 12 -1 M END > CHEBI:65081 > 2-oxo-3-(5-oxofuran-2-ylidene)propanoate > A 2-oxo monocarboxylic acid anion that is the conjugate base of 2-oxo-3-(5-oxofuran-2-ylidene)propanoic acid, obtained by deprotonation of the carboxy group; major species at pH 7.3. > 3 > 2-oxo-3-(5-oxofuran-2-ylidene)propanoate(1-); 2-oxo-3-(5-oxofuran-2-ylidene)propanoate > (3Z)-2-oxo-3-(5-oxofuran-2(5H)-ylidene)propanoate > C7H3O5 > 167.09570 > 166.99860 > -1 > [O-]C(=O)C(=O)\C=C1OC(=O)C=C/1 > InChI=1S/C7H4O5/c8-5(7(10)11)3-4-1-2-6(9)12-4/h1-3H,(H,10,11)/p-1/b4-3- > DDHFXYAKWRQJJH-ARJAWSKDSA-M > 21498645 $$$$