Ketcher 03081811252D 1 1.00000 0.00000 0 19 18 0 1 0 999 V2000 6.2569 -8.8761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3908 -8.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5247 -8.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3908 -7.3761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6587 -8.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6588 -7.3761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7927 -8.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4530 -11.8760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5869 -11.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7209 -11.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5869 -10.3760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8549 -11.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8549 -10.3761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9889 -11.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9888 -9.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1228 -10.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9888 -8.8761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2569 -9.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3908 -10.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 2 3 1 0 0 0 2 4 2 0 0 0 3 5 1 0 0 0 5 6 1 1 0 0 5 7 1 0 0 0 8 9 1 0 0 0 9 10 1 0 0 0 9 11 2 0 0 0 10 12 1 0 0 0 12 13 1 1 0 0 12 14 1 0 0 0 13 15 1 0 0 0 15 16 1 0 0 0 15 17 2 0 0 0 16 18 1 0 0 0 18 1 1 1 0 0 18 19 1 0 0 0 M END > CHEBI:140388 > (3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutanoyl]oxy}butanoyl]oxy}butanoic acid > A diester resulting from the formal sequential esterification of the hydroxy group of one molecule of (3R)-3-hydroxybutyric acid with the carboxy group of a second, followed by the esterification of the hydroxy group of the product with the carboxy group of a third molecule of (3R)-3-hydroxybutyric acid. Isolated from the Japanese inedible mushroom Hypoxylon truncatum and also the sponge-derived actinomycete Micromonospora sp. RV43. > 3 > (3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutyryl]oxy}butyryl]oxy}butyric acid > (3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutanoyl]oxy}butanoyl]oxy}butanoic acid > C12H20O7 > 276.283 > 276.12090 > 0 > O(C(C[C@H](O)C)=O)[C@@H](CC(O[C@@H](CC(O)=O)C)=O)C > InChI=1S/C12H20O7/c1-7(13)4-11(16)19-9(3)6-12(17)18-8(2)5-10(14)15/h7-9,13H,4-6H2,1-3H3,(H,14,15)/t7-,8-,9-/m1/s1 > CWLWBMWELZSMPG-IWSPIJDZSA-N > 8216073 > 14695807; 28355070 $$$$