Marvin 03161011492D 30 33 0 0 0 0 999 V2000 0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.8250 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1433 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1433 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0001 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 2.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 3.2999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 4.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8578 3.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 4.5374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8578 4.1249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.5723 4.5374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8578 1.6500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 3.5723 0.4125 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 2.8578 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5723 1.2375 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 4.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0012 4.5374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 7 2 0 0 0 0 1 2 1 0 0 0 0 2 8 2 0 0 0 0 3 9 2 0 0 0 0 4 3 1 0 0 0 0 1 4 1 0 0 0 0 4 15 1 0 0 0 0 2 5 1 0 0 0 0 5 6 1 0 0 0 0 3 6 1 0 0 0 0 6 11 2 0 0 0 0 7 14 1 0 0 0 0 8 10 1 0 0 0 0 9 12 1 0 0 0 0 14 10 2 0 0 0 0 11 13 1 0 0 0 0 12 13 2 0 0 0 0 14 27 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 18 20 1 0 0 0 0 19 21 1 0 0 0 0 20 22 1 0 0 0 0 21 23 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 27 25 1 0 0 0 0 27 26 1 0 0 0 0 27 28 1 0 0 0 0 24 29 1 0 0 0 0 29 30 1 0 0 0 0 M END > CHEBI:5123 > fluphenazine > A member of the class of phenothiazines that is 10H-phenothiazine having a trifluoromethyl subsitituent at the 2-position and a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the N-10 position. > 3 > Triflumethazine; Fluphenazine; Fluorphenazine; Fluorophenazine; Fluorfenazine; flufenazina; 4-(3-(2-trifluoromethyl-10-phenothiazyl)-propyl)-1-piperazineethanol; 4-(3-(2-(trifluoromethyl)-10H-phenothiazin-10-yl)propyl)-1-piperazineethanol; 4-(3-(-trifluoromethyl-10-phenothiazyl)-propyl)-1-piperazineethanol; 2-(trifluoromethyl)-10-(3-(1-(beta-hydroxyethyl)-4-piperazinyl)propyl)phenothiazine; 2-(4-(3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl)-1-piperazinyl)ethanol; 10-(3-(2-hydroxyethyl)piperazinopropyl)-2-(trifluoromethyl)phenothiazine; 10-(3'-(4''-(beta-hydroxyethyl)-1''-piperazinyl)-propyl)-3-trifluoromethylphenothiazine; 1-(2-hydroxyethyl)-4-(3-(trifluoromethyl-10-phenothiazinyl)propyl)-piperazine > 2-(4-{3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl}piperazin-1-yl)ethan-1-ol > fluphenazinum; fluphenazine > C22H26F3N3OS > 437.52200 > 437.17487 > 0 > OCCN1CCN(CCCN2c3ccccc3Sc3ccc(cc23)C(F)(F)F)CC1 > InChI=1S/C22H26F3N3OS/c23-22(24,25)17-6-7-21-19(16-17)28(18-4-1-2-5-20(18)30-21)9-3-8-26-10-12-27(13-11-26)14-15-29/h1-2,4-7,16,29H,3,8-15H2 > PLDUPXSUYLZYBN-UHFFFAOYSA-N > 61643 > 69-23-8 > 1231182 > 61643 > 69-23-8 > DB00623 > C07010 > D07977 > LSM-3226 > 69-23-8 > Fluphenazine > 13950763; 16117689; 1650428; 16839522; 25595294; 5128930 $$$$