Marvin 08231214102D 26 28 0 0 0 0 999 V2000 11.2666 -34.1784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2666 -32.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4184 -32.1834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5703 -32.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5703 -34.1784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4184 -34.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7221 -32.1834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8738 -32.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8738 -34.1784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7221 -34.8434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.0257 -32.1834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.0258 -30.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8740 -30.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.0257 -34.8434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 18.1775 -30.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.1776 -28.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.0258 -28.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8740 -28.8584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7221 -30.8534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 18.1772 -32.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.3491 -32.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.4946 -32.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.3495 -30.8538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.0257 -26.8383 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0 18.1724 -26.1761 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 15.8848 -26.1801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 3 1 0 0 0 0 3 4 2 0 0 0 0 4 5 1 0 0 0 0 5 6 2 0 0 0 0 1 6 1 0 0 0 0 4 7 1 0 0 0 0 7 8 2 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 5 10 1 0 0 0 0 8 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 9 14 2 0 0 0 0 12 15 2 0 0 0 0 15 16 1 0 0 0 0 16 17 2 0 0 0 0 17 18 1 0 0 0 0 13 18 2 0 0 0 0 7 19 1 0 0 0 0 11 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 21 23 2 0 0 0 0 17 24 1 0 0 0 0 24 25 1 0 0 0 0 24 26 2 0 0 0 0 M CHG 2 24 1 25 -1 M END > CHEBI:53766 > acenocoumarol > A hydroxycoumarin that is warfarin in which the hydrogen at position 4 of the phenyl substituent is replaced by a nitro group. > 3 > CHEBI:494206 > Nitrowarfarin; Nitrovarfarian; Nitrophenylacetylethyl-4-hydroxycoumarine; Nicumalon; Nicoumalone; Acenokumarin; Acenocumarolo; Acenocoumarin; 4-Hydroxy-3-[1-(4-nitrophenyl)-3-oxobutyl]-2H-chromen-2-one; 4-Hydroxy-3-(1-(4-nitrophenyl)-3-oxobutyl)-2H-1-benzopyran-2-one; 3-(alpha-p-Nitrophenyl-beta-acetylethyl)-4-hydroxycoumarin; 3-(alpha-Acetonyl-p-nitrobenzyl)-4-hydroxycoumarin; 3-(alpha-Acetonyl-4-nitrobenzyl)-4-hydroxycoumarin; 3-(alpha-(p-Nitrophenol)-beta-acetylethyl)-4-hydroxycoumarin; 3-(alpha-(4'-Nitrophenyl)-beta-acetylethyl)-4-hydroxycoumarin > 4-hydroxy-3-[1-(4-nitrophenyl)-3-oxobutyl]-2H-chromen-2-one > acenocumarol; acenocoumarolum; acenocoumarol; acenocoumarol > C19H15NO6 > 353.32550 > 353.08994 > 0 > CC(=O)CC(c1ccc(cc1)[N+]([O-])=O)c1c(O)c2ccccc2oc1=O > InChI=1S/C19H15NO6/c1-11(21)10-15(12-6-8-13(9-7-12)20(24)25)17-18(22)14-4-2-3-5-16(14)26-19(17)23/h2-9,15,22H,10H2,1H3 > VABCILAOYCMVPS-UHFFFAOYSA-N > 152-72-7 > 1269370 > 152-72-7 > DB01418 > D07064 > LSM-5112 > 152-72-7 > 17275317 $$$$