Marvin 03121210192D 16 16 0 0 0 0 999 V2000 13.0717 -6.1240 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 12.3519 -4.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5994 -4.9139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7423 -5.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7210 -6.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4476 -6.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1657 -6.5556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1657 -5.7367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4605 -5.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8838 -5.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0664 -3.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3519 -3.6768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0664 -4.9143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 13.7808 -4.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7808 -3.6768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4953 -4.9143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3 2 1 0 0 0 0 8 10 1 0 0 0 0 9 4 2 0 0 0 0 5 4 1 0 0 0 0 6 5 2 0 0 0 0 7 6 1 0 0 0 0 8 7 2 0 0 0 0 9 8 1 0 0 0 0 3 10 3 0 0 0 0 12 2 2 0 0 0 0 2 13 1 0 0 0 0 11 12 1 0 0 0 0 13 14 2 0 0 0 0 14 15 1 0 0 0 0 11 15 2 0 0 0 0 14 16 1 0 0 0 0 M END > CHEBI:64158 > 2-methyl-6-(phenylethynyl)pyridine hydrochloride > A hydrochloride salt obtained by reaction of 2-methyl-6-(phenylethynyl)pyridine with one equivalent of hydrochloric acid. Potent and highly selective non-competitive antagonist at the mGlu5 receptor subtype (IC50 = 36 nM) and a positive allosteric modulator at mGlu4 receptors. Centrally active following systemic administration in vivo. Reverses mechanical hyperalgesia in the inflamed rat hind paw. > 3 > MPEP hydrochloride; 6-methyl-2-(phenylethynyl)pyridinium chloride; 6-methyl-2-(phenylethynyl)pyridine hydrochloride; 2-methyl-6-(phenylethynyl)pyridinium chloride > 2-methyl-6-(phenylethynyl)pyridine hydrochloride > C14H12ClN > 229.70500 > 229.06583 > 0 > Cl.Cc1cccc(n1)C#Cc1ccccc1 > InChI=1S/C14H11N.ClH/c1-12-6-5-9-14(15-12)11-10-13-7-3-2-4-8-13;/h2-9H,1H3;1H > PKDHDJBNEKXCBI-UHFFFAOYSA-N > 9652435 > 20347777 $$$$