Marvin 05210914222D 17 18 0 0 0 0 999 V2000 0.0414 0.6559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7560 0.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6731 0.2451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0414 1.4809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7560 -0.5834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4740 0.6559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6731 -0.5834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3877 0.6559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6731 1.8952 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1.4740 -0.9977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1852 0.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3877 -0.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1023 0.2451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1852 -0.5834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1023 -0.5834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9032 -0.9977 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 -2.8203 -0.9942 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 3 1 0 0 0 0 1 4 2 0 0 0 0 2 5 2 0 0 0 0 2 6 1 0 0 0 0 3 7 1 0 0 0 0 3 8 2 0 0 0 0 4 9 1 0 0 0 0 5 10 1 0 0 0 0 6 11 2 0 0 0 0 7 12 2 0 0 0 0 8 13 1 0 0 0 0 10 14 2 0 0 0 0 12 15 1 0 0 0 0 14 16 1 0 0 0 0 15 17 1 0 0 0 0 11 14 1 0 0 0 0 13 15 2 0 0 0 0 M END > CHEBI:27454 > 1-chloro-2,2-bis(4'-chlorophenyl)ethylene > A chlorophenylethylene that is chloroethene in which the methylene hydrogens are replaced by 4-chlorophenyl groups. > 3 > CHEBI:619; CHEBI:19035 > DDMU; 4,4'-DDMU; 2,2-Bis(p-chlorophenyl)-1-chloroethylene; 2,2-Bis(4-chlorophenyl)-1-chloroethylene; 1-Chloro-2,2-bis(p-chlorophenyl)ethylene; 1-Chloro-2,2-bis(4'-chlorophenyl)ethylene; 1-Chloro-2,2-bis(4'-chlorophenyl)ethylene; 1,1-Bis(p-chlorophenyl)-2-chloroethylene; 1,1-Bis(p-chlorophenyl)-2-chloroethene; 1,1-bis(4-chlorophenyl)-2-chloroethylene > C14H9Cl3 > 283.58000 > 281.97698 > 0 > ClC=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 > InChI=1S/C14H9Cl3/c15-9-14(10-1-5-12(16)6-2-10)11-3-7-13(17)8-4-11/h1-9H > LNKQQZFLNUVWQQ-UHFFFAOYSA-N > 1461623 > 1022-22-6 > 1461623 > 1022-22-6 > C06637 > 21792584; 23146667 $$$$