Marvin 07150816482D 24 23 0 0 0 0 999 V2000 -2.1434 0.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8579 -0.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -0.2241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -0.2241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 0.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -0.2241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -0.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 0.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 0.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 -0.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5724 0.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2868 -0.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0013 0.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7158 -0.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 0.1884 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 5.0013 0.1884 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 3.5723 1.0134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 1.0133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7144 1.0133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1434 1.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0013 1.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5723 -0.6367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -0.6366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 21 1 0 0 0 0 1 2 1 0 0 0 0 4 5 1 0 0 0 0 5 7 1 0 0 0 0 7 8 2 0 0 0 0 8 20 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 11 1 2 0 0 0 0 10 11 1 0 0 0 0 2 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 2 0 0 0 0 14 22 1 0 0 0 0 14 15 1 0 0 0 0 16 4 1 0 0 0 0 16 3 1 0 0 0 0 16 18 2 0 0 0 0 16 23 1 0 0 0 0 17 6 1 0 0 0 0 3 17 1 0 0 0 0 17 19 2 0 0 0 0 17 24 1 0 0 0 0 M END > CHEBI:17407 > 2-trans,6-trans-farnesyl diphosphate > The trans,trans-stereoisomer of farnesyl diphosphate. > 3 > CHEBI:12874; CHEBI:11491; CHEBI:42496; CHEBI:10700; CHEBI:11488; CHEBI:12854; CHEBI:19789 > trans-trans-farnesyl diphosphate; trans,trans-farnesyl diphosphate; trans,trans-Farnesyl diphosphate; trans,trans-farnesyl diphosphate; Farnesyl pyrophosphate; FARNESYL DIPHOSPHATE; Farnesyl diphosphate; all-trans-farnesyl pyrophosphate; 2-trans,6-trans-farnesyl pyrophosphate; 2-trans,6-trans-Farnesyl diphosphate; 2-trans,6-trans-farnesyl diphosphate; (E,E)-farnesyl pyrophosphate; (all-E)-farnesyl diphosphate; (2E,6E)-farnesyl pyrophosphate; (2E,6E)-Farnesyl diphosphate; (2E,6E)-farnesyl diphosphate; (2E,6E)-farnesol diphosphate > (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl trihydrogen diphosphate > C15H28O7P2 > 382.32610 > 382.13103 > 0 > CC(C)=CCC\C(C)=C\CC\C(C)=C\COP(O)(=O)OP(O)(O)=O > InChI=1S/C15H28O7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H2,16,17,18)/b14-9+,15-11+ > VWFJDQUYCIWHTN-YFVJMOTDSA-N > 2482197 > 13058-04-3 > 2482197 > 372-97-4 > C00448 > C00007268 > LMPR0103010002 > FPP > 7753173 $$$$