Marvin 02091117112D 19 19 0 0 1 0 999 V2000 12.3674 -12.5312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6542 -12.9393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 13.0805 -12.9393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3674 -11.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6542 -13.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9376 -12.5312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7972 -12.5312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0805 -11.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7937 -11.7118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5069 -11.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.2200 -11.7118 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 15.9366 -11.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.2200 -12.5347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 16.6463 -11.7118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.9366 -10.4706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9357 -11.7216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2137 -11.3068 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 12.3791 -14.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3793 -15.0110 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 3 2 0 0 0 0 1 4 1 0 0 0 0 2 5 1 0 0 0 0 2 6 1 0 0 0 0 3 7 1 0 0 0 0 4 8 2 0 0 0 0 7 9 2 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 11 13 1 1 0 0 0 12 14 1 0 0 0 0 12 15 2 0 0 0 0 8 9 1 0 0 0 0 6 16 1 0 0 0 0 16 17 1 0 0 0 0 5 18 1 0 0 0 0 18 19 1 0 0 0 0 M END > CHEBI:28876 > melphalan > A phenylalanine derivative comprising L-phenylalanine having [bis(2-chloroethyl)amino group at the 4-position on the phenyl ring. > 3 > CHEBI:25815; CHEBI:6742 > Phenylalanine nitrogen mustard; Phenylalanine mustard; p-N-Bis(2-chloroethyl)amino-L-phenylalanine; p-N,N-bis(2-chloroethyl)amino-L-phenylalanine; p-L-Sarcolysin; p-Di-(2-chloroethyl)amino-L-phenylalanine; p-Bis(beta-chloroethyl)aminophenylalanine; L-Sarcolysine; L-Phenylalanine mustard; L-PAM; L-3-(p-(Bis(2-chloroethyl)amino)phenyl)alanine; 4-(Bis(2-chloroethyl)amino)-L-phenylalanine; 3-p-(Di(2-chloroethyl)amino)-phenyl-L-alanine; 3-(p-(Bis(2-chloroethyl)amino)phenyl)-L-alanine > 4-[bis(2-chloroethyl)amino]-L-phenylalanine > melphalanum; melphalan; melfalano > C13H18Cl2N2O2 > 305.20000 > 304.07453 > 0 > N[C@@H](Cc1ccc(cc1)N(CCCl)CCCl)C(O)=O > InChI=1S/C13H18Cl2N2O2/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19/h1-4,12H,5-9,16H2,(H,18,19)/t12-/m0/s1 > SGDBTWWWUNNDEQ-LBPRGKRZSA-N > 148-82-3 > 2816456 > 148-82-3 > DB01042 > D00369 > Melphalan > 10820424; 10937717; 11680815; 11914777; 18481314; 445303; 7494795; 7605343; 8552138; 8951232; 9218926; 9250538 $$$$