Marvin 04021315082D 14 14 0 0 1 0 999 V2000 8.2473 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9461 -7.8581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.8439 -6.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6575 -6.6655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5448 -7.8545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6484 -7.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3473 -7.8581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6519 -6.5473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0496 -7.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7520 -7.8581 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 12.4509 -7.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7554 -8.6717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 13.1497 -7.8581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4543 -6.5473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 3 1 0 0 0 0 1 4 1 0 0 0 0 1 5 1 0 0 0 0 2 6 1 0 0 0 0 6 7 1 0 0 0 0 6 8 2 0 0 0 0 7 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 10 12 1 1 0 0 0 11 13 1 0 0 0 0 11 14 2 0 0 0 0 3 4 1 0 0 0 0 M END > CHEBI:3875 > coprine > A non-proteinogenic L-α-amino acid that is L-glutamine in which one of the hydrogens attached to the amide nitrogen is replaced by a 1-hydroxycyclopropyl group. Found in the ink-cap mushroom, Coprinus atramentarius, it causes an unpleasant hypersensitivity to alcohol (the 'disulfiram effect'). > 3 > N(5)-(1-hydroxycyclopropyl)-L-glutamine; L-coprine; (2S)-2,5-diamino-5-oxopentanoic acid > N-(1-hydroxycyclopropyl)-L-glutamine > C8H14N2O4 > 202.20780 > 202.09536 > 0 > N[C@@H](CCC(=O)NC1(O)CC1)C(O)=O > InChI=1S/C8H14N2O4/c9-5(7(12)13)1-2-6(11)10-8(14)3-4-8/h5,14H,1-4,9H2,(H,10,11)(H,12,13)/t5-/m0/s1 > OEEZRBUCLFMTLD-YFKPBYRVSA-N > 58919-61-2 > 2053887 > 58919-61-2 > C08271 > C00001349 > 1241098; 1553385; 2474765; 350009; 473235; 558210; 577107; 7097272; 7159468 $$$$