Marvin 10020616502D 29 32 0 0 1 0 999 V2000 0.7146 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7144 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1434 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7146 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6986 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2137 -0.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -0.8250 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4290 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4290 -0.8250 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7146 -0.4125 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7146 0.4125 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4290 0.8250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2137 1.0800 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1434 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8579 -1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.8250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7145 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2137 1.9050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4992 2.3175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9282 2.3175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6427 1.9050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9282 1.4925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4290 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7144 -0.4125 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7144 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14 1 1 0 0 0 0 14 10 1 0 0 0 0 14 12 1 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 2 0 0 0 0 3 28 1 0 0 0 0 4 18 1 0 0 0 0 18 5 1 0 0 0 0 5 6 1 0 0 0 0 6 28 1 0 0 0 0 28 10 1 0 0 0 0 10 20 1 0 0 0 0 20 7 1 0 0 0 0 7 16 1 0 0 0 0 16 17 1 0 0 0 0 16 12 1 0 0 0 0 17 8 1 0 0 0 0 8 9 1 0 0 0 0 9 12 1 0 0 0 0 10 11 1 6 0 0 0 12 13 1 6 0 0 0 14 15 1 1 0 0 0 17 26 1 6 0 0 0 17 22 1 0 0 0 0 22 24 1 0 0 0 0 18 19 2 0 0 0 0 20 21 1 1 0 0 0 22 23 2 0 0 0 0 24 25 1 0 0 0 0 16 27 1 1 0 0 0 28 29 1 1 0 0 0 M END > CHEBI:17650 > cortisol > A 17α-hydroxy-C21-steroid that is pregn-4-ene substituted by oxo groups at positions 3 and 20 and hydroxy groups at positions 11, 17 and 21. Cortisol is a corticosteroid hormone or glucocorticoid produced by zona fasciculata of the adrenal cortex, which is a part of the adrenal gland. It is usually referred to as the "stress hormone" as it is involved in response to stress and anxiety, controlled by corticotropin-releasing hormone (CRH). It increases blood pressure and blood sugar, and reduces immune responses. > 3 > CHEBI:3893; CHEBI:14023; CHEBI:24633; CHEBI:58221 > Reichstein's substance M; Kendall's compound F; Hydrocortisone; cortisol; Cortisol; 4-pregnen-11beta,17alpha,21-triol-3,20-dione; 17-hydroxycorticosterone; 11beta-hydrocortisone; 11beta,17alpha,21-trihydroxy-4-pregnene-3,20-dione; 11beta,17alpha,21-Trihydroxy-4-pregnene-3,20-dione; (11beta)-11,17,21-trihydroxypregn-4-ene-3,20-dione > 11beta,17,21-trihydroxypregn-4-ene-3,20-dione > hydrocortisonum; hydrocortisone; hidrocortisona > C21H30O5 > 362.45990 > 362.20932 > 0 > [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]1(C)[C@@]2([H])CC[C@]1(O)C(=O)CO > InChI=1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1 > JYGXADMDTFJGBT-VWUMJDOOSA-N > 1354819 > 50-23-7 > 50-23-7 > DB00741 > C00735 > D00088 > LSM-5980 > LMST02030001 > 50-23-7 > HCY > Hydrocortisone > 10438974; 2268561 $$$$