(2S)-2-azaniumyl-4-(methylcarbamoyl)butanoate CDK 2/12/10,15:27 11 10 0 0 0 0 0 0 0 0999 V2000 -0.7145 -0.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 0.1650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 0.1650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -0.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.1650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 0.9900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 0.9900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1434 -0.2475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -1.0725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -0.2475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8579 0.1650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 2 7 2 0 0 0 0 2 8 1 0 0 0 0 3 6 2 0 0 0 0 10 3 1 0 0 0 0 3 4 1 0 0 0 0 4 9 1 1 0 0 0 5 1 1 0 0 0 0 4 5 1 0 0 0 0 11 8 1 0 0 0 0 M CHG 1 9 1 M CHG 1 10 -1 M END > CHEBI:58200 > N(5)-methyl-L-glutamine zwitterion > The amino acid zwitterion arising from transfer of a proton from the carboxy to the amino group of N5-methyl-L-glutamine; major species at pH 7.3. > 3 > N(5)-methyl-L-glutamine; (2S)-2-ammonio-5-(methylamino)-5-oxopentanoate > (2S)-2-azaniumyl-5-(methylamino)-5-oxopentanoate > C6H12N2O3 > 160.17110 > 160.08479 > 0 > CNC(=O)CC[C@H]([NH3+])C([O-])=O > InChI=1S/C6H12N2O3/c1-8-5(9)3-2-4(7)6(10)11/h4H,2-3,7H2,1H3,(H,8,9)(H,10,11)/t4-/m0/s1 > ONXPDKGXOOORHB-BYPYZUCNSA-N $$$$