Marvin 06250717252D 19 18 0 0 0 0 999 V2000 -4.9063 0.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1918 1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3339 1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2385 0.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4773 0.6875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8095 0.6875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5240 1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7628 1.9250 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 0.0950 1.9250 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -0.6194 0.6875 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -2.0484 0.6875 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -2.7628 1.1000 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 0.0950 1.1000 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 -2.9764 0.3031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3930 -0.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6065 -1.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3086 0.3031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2748 -0.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0613 -1.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 5 1 0 0 0 0 5 12 1 0 0 0 0 12 11 1 0 0 0 0 11 3 1 0 0 0 0 3 10 1 0 0 0 0 10 13 1 0 0 0 0 13 6 1 0 0 0 0 6 7 1 0 0 0 0 7 4 1 0 0 0 0 12 14 1 0 0 0 0 13 17 1 0 0 0 0 12 8 2 0 0 0 0 13 9 2 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 M END > CHEBI:38663 > ethion > An organic thiophosphate that is S,S'-methanediyl bis[dihydrogen (phosphorodithioate)] in which all the hydroxy groups have been converted to their corresponding ethyl esters respectively. Ethion is an organophosphate insecticide with inhibitory activity towards the enzyme acetylcholinesterase ( EC 3.1.1.7). > 3 > S,S'-Methylene bis(O,O-diethyl phosphorodithioate); O,O,O',O'-Tetraethyl S,S'-methylenebis(phosphorodithioate); O,O,O',O'-tetraethyl S,S'-methanediyl bis(dithiophosphate); Bis(S-(diethoxyphosphinothioyl)mercapto)methane > O,O,O',O'-tetraethyl S,S'-methanediyl bis(phosphorodithioate) > C9H22O4P2S4 > 384.48010 > 383.98762 > 0 > CCOP(=S)(OCC)SCSP(=S)(OCC)OCC > InChI=1S/C9H22O4P2S4/c1-5-10-14(16,11-6-2)18-9-19-15(17,12-7-3)13-8-4/h5-9H2,1-4H3 > RIZMRRKBZQXFOY-UHFFFAOYSA-N > 1804530 > 563-12-2 > 1804530 > 563-12-2 > C18725 > 563-12-2 > Ethion > 21366965; 21560835; 23127602; 24398360; 24401442 $$$$