ADP

ADENOSINE-5'-DIPHOSPHATE

ADP
Formula: C10 H15 N5 O10 P2
Molecular weight: 427 Da
One-letter code: A
IUPAC InChI: InChI=1S/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-27(21,22)25-26(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1
IUPAC InChI key: XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES:
OpenEye OEToolkits [1.5.0]:
c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO[P@](=O)(O)OP(=O)(O)O)O)O)N
Environment details