HEM

PROTOPORPHYRIN IX CONTAINING FE

HEM
Formula: C34 H32 Fe N4 O4
Molecular weight: 616 Da
SMILES:
OpenEye OEToolkits [1.7.6]:
Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O