NAG

N-ACETYL-D-GLUCOSAMINE

NAG
Formula: C8 H15 N O6
Molecular weight: 221 Da
IUPAC InChI: InChI=1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6-,7-,8-/m1/s1
IUPAC InChI key: OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES:
OpenEye OEToolkits [1.7.6]:
CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O)CO)O)O
Environment details