MAN

ALPHA-D-MANNOSE

MAN
Formula: C6 H12 O6
Molecular weight: 180 Da
IUPAC InChI: InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5+,6+/m1/s1
IUPAC InChI key: WQZGKKKJIJFFOK-PQMKYFCFSA-N
SMILES:
OpenEye OEToolkits [1.5.0]:
C([C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)O)O)O)O)O
Environment details