FUC

ALPHA-L-FUCOSE

FUC
Formula: C6 H12 O5
Molecular weight: 164 Da
SMILES:
OpenEye OEToolkits [1.5.0]:
C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O)O)O)O
Environment details