BMA

BETA-D-MANNOSE

BMA
Formula: C6 H12 O6
Molecular weight: 180 Da
SMILES:
OpenEye OEToolkits [1.5.0]:
C([C@@H]1[C@H]([C@@H]([C@@H]([C@@H](O1)O)O)O)O)O
Environment details