CHEBI:35274 - ammonium ion

Main ChEBI Ontology Automatic Xrefs Reactions Pathways Models
ChEBI Name ammonium ion
Definition Ammonium, NH4+, and derivatives formed by substitution by univalent groups.
Stars This entity has been manually annotated by the ChEBI Team.
ChEBI Ontology
Outgoing ammonium ion (CHEBI:35274) is a nitrogen molecular entity (CHEBI:51143)
ammonium ion (CHEBI:35274) is a polyatomic cation (CHEBI:33702)
Incoming ammonium compound (CHEBI:35276) has part ammonium ion (CHEBI:35274)
β-D-galactosyl-(1↔1ʼ)-sphinganine(1+) (CHEBI:83234) is a ammonium ion (CHEBI:35274)
β-alaninium amide (CHEBI:58918) is a ammonium ion (CHEBI:35274)
γ-L-glutamylbutirosin B(3+) (CHEBI:65086) is a ammonium ion (CHEBI:35274)
γ-L-glutamylputrescinium(1+) (CHEBI:58731) is a ammonium ion (CHEBI:35274)
γ-carboxy-L-glutamic acid zwitterion(2−) (CHEBI:61938) is a ammonium ion (CHEBI:35274)
(±)-5-[3-(tert-butylammonio)-2-hydroxypropoxy]-1,2,3,4-tetrahydro-1-naphthol(1+) (CHEBI:58611) is a ammonium ion (CHEBI:35274)
(±)-5-[3-(tert-butylammonio)-2-hydroxypropoxy]-3,4-dihydronaphthalen-1(2H)-one(1+) (CHEBI:58612) is a ammonium ion (CHEBI:35274)
(−)-ephedrinium (CHEBI:57295) is a ammonium ion (CHEBI:35274)
(1R)-1-phenylethanaminium (CHEBI:141112) is a ammonium ion (CHEBI:35274)
(1R,3S)-3-(adamantan-1-yl)-1-(ammoniomethyl)-3,4-dihydroisochromene-5,6-diol(1+) (CHEBI:64079) is a ammonium ion (CHEBI:35274)
(1S)-1-phenylethanaminium (CHEBI:141108) is a ammonium ion (CHEBI:35274)
(1S,2R)-5-methoxy-1-methyl-2-(propylammonio)tetralin(1+) (CHEBI:64118) is a ammonium ion (CHEBI:35274)
(1S,2S,3R,5S)-3,5-diammoniocyclohexane-1,2-diol (CHEBI:72342) is a ammonium ion (CHEBI:35274)
(2R)-2-hydroxypropylammonium (CHEBI:42677) is a ammonium ion (CHEBI:35274)
(2S,3S,5R,10R,12S,14S,15R,16R)-2-amino-12,16-dimethylicosane-3,5,10,14,15-pentol(1+) (CHEBI:62526) is a ammonium ion (CHEBI:35274)
(2S)-2-carbamoylpyrrolidin-1-ium (CHEBI:58495) is a ammonium ion (CHEBI:35274)
(3R)-3-(tert-butylcarbamoyl)piperazin-1-ium (CHEBI:60254) is a ammonium ion (CHEBI:35274)
(4aR,10bS)-noroxomaritidine(1+) (CHEBI:133996) is a ammonium ion (CHEBI:35274)
(4aS,10bR)-noroxomaritidine(1+) (CHEBI:133995) is a ammonium ion (CHEBI:35274)
(6S)-6-hydroxyhyoscyaminium (CHEBI:57459) is a ammonium ion (CHEBI:35274)
(7S)-salutaridinol(1+) (CHEBI:58463) is a ammonium ion (CHEBI:35274)
(R)-2-methylpyrrolidinium (CHEBI:78222) is a ammonium ion (CHEBI:35274)
(R)-6-hydroxynicotinium (CHEBI:58413) is a ammonium ion (CHEBI:35274)
(R)-adrenaline(1+) (CHEBI:71406) is a ammonium ion (CHEBI:35274)
(R)-benproperine(1+) (CHEBI:78391) is a ammonium ion (CHEBI:35274)
(R)-fluoxetine(1+) (CHEBI:86993) is a ammonium ion (CHEBI:35274)
(R)-laudanosine(1+) (CHEBI:134210) is a ammonium ion (CHEBI:35274)
(R)-nefopam(1+) (CHEBI:88325) is a ammonium ion (CHEBI:35274)
(R)-nicotinium(1+) (CHEBI:79008) is a ammonium ion (CHEBI:35274)
(R)-nipecotamide(1+) (CHEBI:60118) is a ammonium ion (CHEBI:35274)
(R)-noradrenaline(1+) (CHEBI:72587) is a ammonium ion (CHEBI:35274)
(R)-orciprenaline(1+) (CHEBI:83340) is a ammonium ion (CHEBI:35274)
(R)-piperazin-4-ium-2-carboxamide(1+) (CHEBI:58916) is a ammonium ion (CHEBI:35274)
(R)-prasugrel(1+) (CHEBI:87727) is a ammonium ion (CHEBI:35274)
(R)-reticulinium(1+) (CHEBI:58144) is a ammonium ion (CHEBI:35274)
(R)-SKF 38393(1+) (CHEBI:131806) is a ammonium ion (CHEBI:35274)
(R)-tetrahydropapaverine(1+) (CHEBI:134211) is a ammonium ion (CHEBI:35274)
(R)-tetrindole(1+) (CHEBI:77793) is a ammonium ion (CHEBI:35274)
(R,R)-asenapine(1+) (CHEBI:71251) is a ammonium ion (CHEBI:35274)
(R,R)-tramadol(1+) (CHEBI:75737) is a ammonium ion (CHEBI:35274)
(R,S,S,S)-nebivolol(1+) (CHEBI:132915) is a ammonium ion (CHEBI:35274)
(RS)-coclaurinium (CHEBI:58481) is a ammonium ion (CHEBI:35274)
(RS)-norcoclaurinium (CHEBI:58482) is a ammonium ion (CHEBI:35274)
(S)-2-aminopropan-1-ol(1+) (CHEBI:85422) is a ammonium ion (CHEBI:35274)
(S)-2-methyl-1-(4-methylisoquinoline-5-sulfonyl)-1,4-diazepane(2+) (CHEBI:138382) is a ammonium ion (CHEBI:35274)
(S)-3'-hydroxy-N-methylcoclaurinium(1+) (CHEBI:58010) is a ammonium ion (CHEBI:35274)
(S)-6-hydroxynicotinium(1+) (CHEBI:58182) is a ammonium ion (CHEBI:35274)
(S)-N-methylcoclaurinium(1+) (CHEBI:57993) is a ammonium ion (CHEBI:35274)
(S)-atropinium (CHEBI:58164) is a ammonium ion (CHEBI:35274)
(S)-benproperine(1+) (CHEBI:78392) is a ammonium ion (CHEBI:35274)
(S)-coclaurinium (CHEBI:57581) is a ammonium ion (CHEBI:35274)
(S)-fluoxetine(1+) (CHEBI:86995) is a ammonium ion (CHEBI:35274)
(S)-glaucine(1+) (CHEBI:134212) is a ammonium ion (CHEBI:35274)
(S)-nefopam(1+) (CHEBI:88324) is a ammonium ion (CHEBI:35274)
(S)-nicotinium(1+) (CHEBI:59806) is a ammonium ion (CHEBI:35274)
(S)-norcoclaurinium(1+) (CHEBI:58253) is a ammonium ion (CHEBI:35274)
(S)-orciprenaline(1+) (CHEBI:83338) is a ammonium ion (CHEBI:35274)
(S)-piperazin-4-ium-2-carboxamide(1+) (CHEBI:58919) is a ammonium ion (CHEBI:35274)
(S)-prasugrel(1+) (CHEBI:87726) is a ammonium ion (CHEBI:35274)
(S)-reticulinium(1+) (CHEBI:57873) is a ammonium ion (CHEBI:35274)
(S)-SKF 38393(1+) (CHEBI:131807) is a ammonium ion (CHEBI:35274)
(S)-tetrindole(1+) (CHEBI:77797) is a ammonium ion (CHEBI:35274)
(S)-verapamil(1+) (CHEBI:77738) is a ammonium ion (CHEBI:35274)
(S,R,R,R)-nebivolol(1+) (CHEBI:132916) is a ammonium ion (CHEBI:35274)
(S,S)-asenapine(1+) (CHEBI:71252) is a ammonium ion (CHEBI:35274)
(S,S)-formoterol(1+) (CHEBI:63110) is a ammonium ion (CHEBI:35274)
(S,S)-tramadol(1+) (CHEBI:75738) is a ammonium ion (CHEBI:35274)
1,1'-[1,9-bis(dimethylammonio)nonane-1,9-diyl]bis{4-[(Z)-(3-methyl-1,3-benzothiazol-2(3H)-ylidene)methyl]quinolinium} (CHEBI:46019) is a ammonium ion (CHEBI:35274)
1,2-distearoylphosphatidylethanolaminium (CHEBI:47769) is a ammonium ion (CHEBI:35274)
1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine(1+) (CHEBI:139161) is a ammonium ion (CHEBI:35274)
1-(5-isoquinolinesulfonyl)-2-methylpiperazine(2+) (CHEBI:83442) is a ammonium ion (CHEBI:35274)
1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidinium(1+) (CHEBI:64146) is a ammonium ion (CHEBI:35274)
1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazinediium(2+) (CHEBI:64092) is a ammonium ion (CHEBI:35274)
1-[6-carboxy-8-(2,4-difluorophenyl)-3-fluoro-5-oxo-5,8-dihydro-1,8-naphthyridin-2-yl]pyrrolidin-3-aminium (CHEBI:77588) is a ammonium ion (CHEBI:35274)
1-ammonio-1-deoxy-scyllo-inositol (CHEBI:57671) is a ammonium ion (CHEBI:35274)
1-benzyl-1,2,3,4-tetrahydroisoquinolin-2-ium (CHEBI:57902) is a ammonium ion (CHEBI:35274)
1-benzyl-2-methyl-1,2,3,4-tetrahydroisoquinolinium (CHEBI:57598) is a ammonium ion (CHEBI:35274)
1-butyl-2-[(2,6-dimethylphenyl)carbamoyl]piperidinium (CHEBI:77457) is a ammonium ion (CHEBI:35274)
1-hexadecyl-2-ammonio-2-deoxy-sn-glycerol (CHEBI:77786) is a ammonium ion (CHEBI:35274)
10-deoxymethymycin(1+) (CHEBI:63307) is a ammonium ion (CHEBI:35274)
13-(2-methylcrotonoyloxy)lupaninium (CHEBI:58460) is a ammonium ion (CHEBI:35274)
13-deoxydaunorubicin(1+) (CHEBI:75297) is a ammonium ion (CHEBI:35274)
13-dihydrodaunorubicin(1+) (CHEBI:75296) is a ammonium ion (CHEBI:35274)
13-hydroxylupaninium (CHEBI:58446) is a ammonium ion (CHEBI:35274)
15-methylhexadecasphing-4-enine-1-phosphocholine(1+) (CHEBI:71021) is a ammonium ion (CHEBI:35274)
16-methoxytabersoninium(1+) (CHEBI:58930) is a ammonium ion (CHEBI:35274)
17-O-acetylajmalinium (CHEBI:58679) is a ammonium ion (CHEBI:35274)
17-hydroxylupanine(1+) (CHEBI:64262) is a ammonium ion (CHEBI:35274)
1D-myo-inositol 2-(L-cysteiniumylamino)-2-deoxy-α-D-glucopyranoside (CHEBI:58887) is a ammonium ion (CHEBI:35274)
1D-myo-inositol 2-ammonio-2-deoxy-α-D-glucopyranoside (CHEBI:58886) is a ammonium ion (CHEBI:35274)
2'''-acetyl-6'''-hydroxyneomycin C(4+) (CHEBI:65030) is a ammonium ion (CHEBI:35274)
2'-N-acetylparomamine(2+) (CHEBI:65010) is a ammonium ion (CHEBI:35274)
2'-deamino-2'-hydroxy-6'-dehydroparomamine(2+) (CHEBI:67214) is a ammonium ion (CHEBI:35274)
2'-deamino-2'-hydroxyneamine(3+) (CHEBI:67213) is a ammonium ion (CHEBI:35274)
2'-deamino-2'-hydroxyparomamine(2+) (CHEBI:65071) is a ammonium ion (CHEBI:35274)
2'-oxokanamycin(4+) (CHEBI:72757) is a ammonium ion (CHEBI:35274)
2,5-diammoniohexanoate (CHEBI:57950) is a ammonium ion (CHEBI:35274)
2,6-diamino-2,3,6-trideoxy-α-D-glucose(2+) (CHEBI:72339) is a ammonium ion (CHEBI:35274)
2,6-dihydroxypseudooxynicotinium(1+) (CHEBI:66944) is a ammonium ion (CHEBI:35274)
2-[3-carboxy-3-(methylammonio)propyl]-L-histidine (CHEBI:16475) is a ammonium ion (CHEBI:35274)
2-ammonio-2-deoxy-D-glucopyranose (CHEBI:58723) is a ammonium ion (CHEBI:35274)
2-arylethylammomium(1+) (CHEBI:77827) is a ammonium ion (CHEBI:35274)
2-chloro-1,4-phenylenediaminium (CHEBI:76599) is a ammonium ion (CHEBI:35274)
2-deoxy-scyllo-inosamine(1+) (CHEBI:65003) is a ammonium ion (CHEBI:35274)
2-deoxystreptamine cation (CHEBI:77452) is a ammonium ion (CHEBI:35274)
2-deoxystreptamine(1+) (CHEBI:72447) is a ammonium ion (CHEBI:35274)
2-deoxystreptamine(2+) (CHEBI:65069) is a ammonium ion (CHEBI:35274)
2-dimethylammonioethyl chloride (CHEBI:78154) is a ammonium ion (CHEBI:35274)
2-phenylethanaminium (CHEBI:225237) is a ammonium ion (CHEBI:35274)
2-{[(2E)-3-iodoprop-2-en-1-yl](propyl)ammonio}tetralin-7-ol(1+) (CHEBI:64138) is a ammonium ion (CHEBI:35274)
2-{[(4-methoxybenzyl)(methyl)amino]methyl}-2-methylpropane-1,3-diol(1+) (CHEBI:139164) is a ammonium ion (CHEBI:35274)
3''-deamino-3''-hydroxykanamycin B(4+) (CHEBI:72944) is a ammonium ion (CHEBI:35274)
3''-deamino-3''-hydroxykanamycin C(3+) (CHEBI:72945) is a ammonium ion (CHEBI:35274)
3''-deamino-3''-hydroxykanamycin X(2+) (CHEBI:72946) is a ammonium ion (CHEBI:35274)
3'-N-debenzoyl-2'-deoxytaxol(1+) (CHEBI:79186) is a ammonium ion (CHEBI:35274)
3'-N-debenzoyltaxol(1+) (CHEBI:63863) is a ammonium ion (CHEBI:35274)
3'-demethylstaurosporinium(1+) (CHEBI:57473) is a ammonium ion (CHEBI:35274)
3,3'-neotrehalosadiamine(2+) (CHEBI:75053) is a ammonium ion (CHEBI:35274)
3,3,3-tetraminium(4+) (CHEBI:58704) is a ammonium ion (CHEBI:35274)
3-(methylaminomethyl)indole(1+) (CHEBI:136515) is a ammonium ion (CHEBI:35274)
3-[5-cyano-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-1-yl]-N,N-dimethylpropan-1-aminium (CHEBI:77408) is a ammonium ion (CHEBI:35274)
3-ammonio-2,3-dideoxy-scyllo-inosose(1+) (CHEBI:65002) is a ammonium ion (CHEBI:35274)
3-ammoniopropanal (CHEBI:58374) is a ammonium ion (CHEBI:35274)
3-hydroxyquininium (CHEBI:58234) is a ammonium ion (CHEBI:35274)
3-methylthiopropylaminium (CHEBI:57866) is a ammonium ion (CHEBI:35274)
4'-O-methylnorbelladine(1+) (CHEBI:133993) is a ammonium ion (CHEBI:35274)
4-(3-chlorophenyl)-1-(2-hydroxy-3,3-diphenylpropyl)piperazin-1-ium(1+) (CHEBI:64059) is a ammonium ion (CHEBI:35274)
4-O-methylrhodomycin D(1+) (CHEBI:77074) is a ammonium ion (CHEBI:35274)
4-O-phosphohygromycin B(1+) (CHEBI:59917) is a ammonium ion (CHEBI:35274)
4-amino-5-ammoniomethyl-2-methylpyrimidine (CHEBI:63416) is a ammonium ion (CHEBI:35274)
4-ammoniobutanal (CHEBI:58264) is a ammonium ion (CHEBI:35274)
4-fluoro-N-{2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl}benzamide(1+) (CHEBI:64100) is a ammonium ion (CHEBI:35274)
4-hydroxytryptamine(1+) (CHEBI:139069) is a ammonium ion (CHEBI:35274)
4-methoxy-3-indolylmethylamine(1+) (CHEBI:136935) is a ammonium ion (CHEBI:35274)
5''-phosphoribostamycin(2+) (CHEBI:65082) is a ammonium ion (CHEBI:35274)
5-O-β-D-mycaminosyl-20-oxotylonolide(1+) (CHEBI:76803) is a ammonium ion (CHEBI:35274)
5-O-β-D-mycaminosyltylactone(1+) (CHEBI:76802) is a ammonium ion (CHEBI:35274)
5-O-mycaminosyltylonolide(1+) (CHEBI:76804) is a ammonium ion (CHEBI:35274)
5-amino-5-(4-hydroxybenzyl)-6-(D-ribitylimino)-5,6-dihydrouracil(1+) (CHEBI:85512) is a ammonium ion (CHEBI:35274)
5-aminomethyl-2-thiouridine(1+) (CHEBI:73769) is a ammonium ion (CHEBI:35274)
5-ammoniopentanamide (CHEBI:58382) is a ammonium ion (CHEBI:35274)
5-hydroxykynurenaminium(1+) (CHEBI:62214) is a ammonium ion (CHEBI:35274)
5-nonyloxytryptaminium(1+) (CHEBI:64150) is a ammonium ion (CHEBI:35274)
6'''-hydroxyneomycin C(5+) (CHEBI:65031) is a ammonium ion (CHEBI:35274)
6'''-oxoneomycin C(5+) (CHEBI:65068) is a ammonium ion (CHEBI:35274)
6''-O-carbamoylkanamycin A(4+) (CHEBI:73675) is a ammonium ion (CHEBI:35274)
6'-oxoparomamine(3+) (CHEBI:65016) is a ammonium ion (CHEBI:35274)
6-(α-D-glucosazaniumyl)-1D-myo-inositol (CHEBI:58700) is a ammonium ion (CHEBI:35274)
6-O-methylnorlaudanosolinium (CHEBI:57578) is a ammonium ion (CHEBI:35274)
6-hydroxy-N-methylmyosmine(1+) (CHEBI:87164) is a ammonium ion (CHEBI:35274)
6-hydroxypseudooxynicotinium(1+) (CHEBI:58682) is a ammonium ion (CHEBI:35274)
7''-O-phosphohygromycin B(1+) (CHEBI:57929) is a ammonium ion (CHEBI:35274)
7,8-diaminononanoate cation (CHEBI:58500) is a ammonium ion (CHEBI:35274)
7-O-acetylsalutaridinol(1+) (CHEBI:57672) is a ammonium ion (CHEBI:35274)
7-ammoniomethyl-7-deazaguanine (CHEBI:58703) is a ammonium ion (CHEBI:35274)
ent-diltiazem(1+) (CHEBI:82816) is a ammonium ion (CHEBI:35274)
N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-2-(2,6-dimethoxyphenoxy)ethanaminium(1+) (CHEBI:64097) is a ammonium ion (CHEBI:35274)
N-(3-acetamidopropyl)-4-ammoniobutanal (CHEBI:58858) is a ammonium ion (CHEBI:35274)
N-(3-ammoniopropyl)-4-ammoniobutanal (CHEBI:58869) is a ammonium ion (CHEBI:35274)
N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide(1+) (CHEBI:75369) is a ammonium ion (CHEBI:35274)
N-(ammoniomethyl)urea (CHEBI:57431) is a ammonium ion (CHEBI:35274)
N-[(E)-4-ammoniobutylidene]propane-1,3-diaminium (CHEBI:58732) is a ammonium ion (CHEBI:35274)
N-[2-(4-bromocinnamylamino)ethyl]isoquinoline-5-sulfonamide(2+) (CHEBI:131489) is a ammonium ion (CHEBI:35274)
N-acetyl-β-D-glucosaminyl-(1→4)-D-glucosaminium(1+) (CHEBI:59910) is a ammonium ion (CHEBI:35274)
N-acetylcadaverine(1+) (CHEBI:134408) is a ammonium ion (CHEBI:35274)
N-acetylputrescinium (CHEBI:58263) is a ammonium ion (CHEBI:35274)
N-allyl-1-phenyl-2,3,4,5-tetrahydro-3-benzazepinium-7,8-diol(1+) (CHEBI:63987) is a ammonium ion (CHEBI:35274)
N-allyl-6-chloro-1-(3-methylphenyl)-2,3,4,5-tetrahydro-3-benzazepinium-7,8-diol(1+) (CHEBI:64003) is a ammonium ion (CHEBI:35274)
N-caffeoylputrescinium(1+) (CHEBI:58138) is a ammonium ion (CHEBI:35274)
N-carbamoylputrescinium(1+) (CHEBI:58318) is a ammonium ion (CHEBI:35274)
N-methyl-6-chloro-1-(3-methylphenyl)-2,3,4,5-tetrahydro-3-benzazepinium-7,8-diol(1+) (CHEBI:64000) is a ammonium ion (CHEBI:35274)
N-methylphenylethanolaminium (CHEBI:57946) is a ammonium ion (CHEBI:35274)
N-methylputrescinium(2+) (CHEBI:58039) is a ammonium ion (CHEBI:35274)
N-methyltyraminium (CHEBI:58155) is a ammonium ion (CHEBI:35274)
N-monoacetylalkane-α,ω-diamine(1+) (CHEBI:70988) is a ammonium ion (CHEBI:35274)
Nα-acetyl-L-lysine methyl ester(1+) (CHEBI:64854) is a ammonium ion (CHEBI:35274)
Nτ-methylhistaminium (CHEBI:58600) is a ammonium ion (CHEBI:35274)
N1,N12-diacetylsperminium(2+) (CHEBI:58550) is a ammonium ion (CHEBI:35274)
N1,N8-bis(coumaroyl)spermidine(1+) (CHEBI:85007) is a ammonium ion (CHEBI:35274)
N1,N8-bis(sinapoyl)-spermidine(1+) (CHEBI:85006) is a ammonium ion (CHEBI:35274)
N1-acetylspermidinium(2+) (CHEBI:58324) is a ammonium ion (CHEBI:35274)
N1-acetylsperminium(3+) (CHEBI:58101) is a ammonium ion (CHEBI:35274)
N2'-acetylgentamycin C1a(4+) (CHEBI:58552) is a ammonium ion (CHEBI:35274)
N3'-acetyl-2-deoxystreptamine antibiotic(1+) (CHEBI:57921) is a ammonium ion (CHEBI:35274)
N3'-acetylgentamycin C(4+) (CHEBI:75617) is a ammonium ion (CHEBI:35274)
N4-aminopropylspermidine(4+) (CHEBI:82770) is a ammonium ion (CHEBI:35274)
N4-aminopropylspermine(5+) (CHEBI:82772) is a ammonium ion (CHEBI:35274)
N6'-acetylkanamycin B(4+) (CHEBI:58390) is a ammonium ion (CHEBI:35274)
N8-acetylspermidinium(2+) (CHEBI:58535) is a ammonium ion (CHEBI:35274)
O-demethylpuromycin(1+) (CHEBI:58037) is a ammonium ion (CHEBI:35274)
S-acetylcysteaminium (CHEBI:58295) is a ammonium ion (CHEBI:35274)
S-adenosylmethioninaminium (CHEBI:57443) is a ammonium ion (CHEBI:35274)
sym-homospermidinium(3+) (CHEBI:57811) is a ammonium ion (CHEBI:35274)
tert-butylammonium (CHEBI:224366) is a ammonium ion (CHEBI:35274)
D-2-ammoniohexano-6-lactam (CHEBI:58609) is a ammonium ion (CHEBI:35274)
D-cycloserine(1+) (CHEBI:75929) is a ammonium ion (CHEBI:35274)
D-glucosylsphingosine(1+) (CHEBI:62495) is a ammonium ion (CHEBI:35274)
D-ornithinium(1+) (CHEBI:57668) is a ammonium ion (CHEBI:35274)
D-synephrine(1+) (CHEBI:63694) is a ammonium ion (CHEBI:35274)
L-2-ammoniohexano-6-lactam (CHEBI:58113) is a ammonium ion (CHEBI:35274)
L-alaninamide(1+) (CHEBI:74169) is a ammonium ion (CHEBI:35274)
L-histidinal(1+) (CHEBI:64802) is a ammonium ion (CHEBI:35274)
L-histidinol(1+) (CHEBI:57699) is a ammonium ion (CHEBI:35274)
L-homoserine lactone(1+) (CHEBI:58633) is a ammonium ion (CHEBI:35274)
L-tryptophanamide(1+) (CHEBI:57803) is a ammonium ion (CHEBI:35274)
acarbose(1+) (CHEBI:84363) is a ammonium ion (CHEBI:35274)
acebutolol(1+) (CHEBI:62101) is a ammonium ion (CHEBI:35274)
acridine half-mustard(2+) (CHEBI:132981) is a ammonium ion (CHEBI:35274)
adamantan-1-aminium (CHEBI:48320) is a ammonium ion (CHEBI:35274)
agroclavine(1+) (CHEBI:65042) is a ammonium ion (CHEBI:35274)
ajmalinium (CHEBI:58567) is a ammonium ion (CHEBI:35274)
alectinib(1+) (CHEBI:90937) is a ammonium ion (CHEBI:35274)
alkane-α,ω-diammonium(2+) (CHEBI:70977) is a ammonium ion (CHEBI:35274)
alogliptin(1+) (CHEBI:72326) is a ammonium ion (CHEBI:35274)
alverine(1+) (CHEBI:64320) is a ammonium ion (CHEBI:35274)
alvocidib(1+) (CHEBI:90997) is a ammonium ion (CHEBI:35274)
amikacin(4+) (CHEBI:84739) is a ammonium ion (CHEBI:35274)
aminopropylcadaverine(3+) (CHEBI:64858) is a ammonium ion (CHEBI:35274)
ammonioacetaldehyde (CHEBI:58213) is a ammonium ion (CHEBI:35274)
ammonioacetone (CHEBI:58320) is a ammonium ion (CHEBI:35274)
ammoniodiacetate (CHEBI:62745) is a ammonium ion (CHEBI:35274)
ammonium (CHEBI:28938) is a ammonium ion (CHEBI:35274)
amodiaquine(1+) (CHEBI:131327) is a ammonium ion (CHEBI:35274)
amorolfine(1+) (CHEBI:86380) is a ammonium ion (CHEBI:35274)
anthracycline cation (CHEBI:64678) is a ammonium ion (CHEBI:35274)
arformoterol(1+) (CHEBI:63107) is a ammonium ion (CHEBI:35274)
argemonine(1+) (CHEBI:76922) is a ammonium ion (CHEBI:35274)
atropinium (CHEBI:57858) is a ammonium ion (CHEBI:35274)
AZD1979(1+) (CHEBI:138980) is a ammonium ion (CHEBI:35274)
bedaquiline(2+) (CHEBI:72706) is a ammonium ion (CHEBI:35274)
benazepril(1+) (CHEBI:88201) is a ammonium ion (CHEBI:35274)
benethamine(1+) (CHEBI:52149) is a ammonium ion (CHEBI:35274)
benserazide(1+) (CHEBI:64190) is a ammonium ion (CHEBI:35274)
benzathine(1+) (CHEBI:51346) is a ammonium ion (CHEBI:35274)
benzathine(2+) (CHEBI:51345) is a ammonium ion (CHEBI:35274)
benzydamine(1+) (CHEBI:134500) is a ammonium ion (CHEBI:35274)
benzyl cetraxate(1+) (CHEBI:57790) is a ammonium ion (CHEBI:35274)
benzylaminium (CHEBI:225238) is a ammonium ion (CHEBI:35274)
berbamuninium(2+) (CHEBI:57894) is a ammonium ion (CHEBI:35274)
BGT226(1+) (CHEBI:71966) is a ammonium ion (CHEBI:35274)
bis(3-azaniumylpropyl)azanium (CHEBI:57920) is a ammonium ion (CHEBI:35274)
bromhexine(1+) (CHEBI:77040) is a ammonium ion (CHEBI:35274)
buclizine(2+) (CHEBI:61192) is a ammonium ion (CHEBI:35274)
bulbocapnine(1+) (CHEBI:134215) is a ammonium ion (CHEBI:35274)
buspirone(1+) (CHEBI:132102) is a ammonium ion (CHEBI:35274)
butamben(1+) (CHEBI:86302) is a ammonium ion (CHEBI:35274)
butirosin B(4+) (CHEBI:65085) is a ammonium ion (CHEBI:35274)
caldopentamine(4+) (CHEBI:82769) is a ammonium ion (CHEBI:35274)
caldopentamine(5+) (CHEBI:82768) is a ammonium ion (CHEBI:35274)
cariprazine(1+) (CHEBI:90934) is a ammonium ion (CHEBI:35274)
carmoxirole(1+) (CHEBI:64201) is a ammonium ion (CHEBI:35274)
carteolol(1+) (CHEBI:61202) is a ammonium ion (CHEBI:35274)
cationic chitosan (CHEBI:57704) is a ammonium ion (CHEBI:35274)
cationic sphingoid (CHEBI:83876) is a ammonium ion (CHEBI:35274)
CGP 78608(1+) (CHEBI:64066) is a ammonium ion (CHEBI:35274)
chanoclavine-I(1+) (CHEBI:72949) is a ammonium ion (CHEBI:35274)
chloroorienticin B(1+) (CHEBI:75963) is a ammonium ion (CHEBI:35274)
clenbuterol(1+) (CHEBI:61153) is a ammonium ion (CHEBI:35274)
clomipramine(1+) (CHEBI:64209) is a ammonium ion (CHEBI:35274)
cobimetinib(1+) (CHEBI:90854) is a ammonium ion (CHEBI:35274)
cocaine(1+) (CHEBI:60056) is a ammonium ion (CHEBI:35274)
codeine(1+) (CHEBI:57871) is a ammonium ion (CHEBI:35274)
codeinone(1+) (CHEBI:58473) is a ammonium ion (CHEBI:35274)
cyclohexylammonium (CHEBI:42939) is a ammonium ion (CHEBI:35274)
cysteaminium (CHEBI:58029) is a ammonium ion (CHEBI:35274)
deacetylisoipecoside(1+) (CHEBI:58091) is a ammonium ion (CHEBI:35274)
deaminohydroxyblasticidin S(1+) (CHEBI:57697) is a ammonium ion (CHEBI:35274)
demethyllactenocin(1+) (CHEBI:76810) is a ammonium ion (CHEBI:35274)
demethylmacrocin(1+) (CHEBI:76819) is a ammonium ion (CHEBI:35274)
dexverapamil(1+) (CHEBI:77737) is a ammonium ion (CHEBI:35274)
dihydrochanoclavine-I aldehyde(1+) (CHEBI:65032) is a ammonium ion (CHEBI:35274)
diltiazem(1+) (CHEBI:82812) is a ammonium ion (CHEBI:35274)
dipivefrin(1+) (CHEBI:73714) is a ammonium ion (CHEBI:35274)
dopaminium(1+) (CHEBI:59905) is a ammonium ion (CHEBI:35274)
E-3810(1+) (CHEBI:65208) is a ammonium ion (CHEBI:35274)
ecgoninium methyl ester(1+) (CHEBI:59908) is a ammonium ion (CHEBI:35274)
ecgononium methyl ester(1+) (CHEBI:66941) is a ammonium ion (CHEBI:35274)
eletriptan(1+) (CHEBI:61177) is a ammonium ion (CHEBI:35274)
eliglustat(1+) (CHEBI:83355) is a ammonium ion (CHEBI:35274)
epoxyqueuine(1+) (CHEBI:77675) is a ammonium ion (CHEBI:35274)
eprazinone(2+) (CHEBI:83323) is a ammonium ion (CHEBI:35274)
eribulin(1+) (CHEBI:70711) is a ammonium ion (CHEBI:35274)
erythromycin cation (CHEBI:64290) is a ammonium ion (CHEBI:35274)
ethidium homodimer tetracation (CHEBI:52843) is a ammonium ion (CHEBI:35274)
ethylaminium (CHEBI:566789) is a ammonium ion (CHEBI:35274)
festuclavine(1+) (CHEBI:65045) is a ammonium ion (CHEBI:35274)
fingolimod(1+) (CHEBI:63113) is a ammonium ion (CHEBI:35274)
flecainide(1+) (CHEBI:76033) is a ammonium ion (CHEBI:35274)
FR901469(1+) (CHEBI:68659) is a ammonium ion (CHEBI:35274)
framycetin(6+) (CHEBI:87835) is a ammonium ion (CHEBI:35274)
fumigaclavine A(1+) (CHEBI:67145) is a ammonium ion (CHEBI:35274)
fumigaclavine B(1+) (CHEBI:67146) is a ammonium ion (CHEBI:35274)
fumigaclavine C(1+) (CHEBI:67147) is a ammonium ion (CHEBI:35274)
fumonisin B1(3-) (CHEBI:62554) is a ammonium ion (CHEBI:35274)
gentamicin C(5+) (CHEBI:75616) is a ammonium ion (CHEBI:35274)
gentamycin C1a(5+) (CHEBI:58530) is a ammonium ion (CHEBI:35274)
gentamycin(2+) (CHEBI:90218) is a ammonium ion (CHEBI:35274)
GGTI-2133 free base(1+) (CHEBI:101333) is a ammonium ion (CHEBI:35274)
glutathionylspermidinium(2+) (CHEBI:57835) is a ammonium ion (CHEBI:35274)
GR 127935(1+) (CHEBI:64113) is a ammonium ion (CHEBI:35274)
gramine(1+) (CHEBI:136516) is a ammonium ion (CHEBI:35274)
histaminium (CHEBI:58432) is a ammonium ion (CHEBI:35274)
homoserinium lactone (CHEBI:58093) is a ammonium ion (CHEBI:35274)
hycanthone(1+) (CHEBI:67141) is a ammonium ion (CHEBI:35274)
hydrabamine(1+) (CHEBI:52170) is a ammonium ion (CHEBI:35274)
hydrabamine(2+) (CHEBI:52171) is a ammonium ion (CHEBI:35274)
hygromycin B(3+) (CHEBI:57971) is a ammonium ion (CHEBI:35274)
indacaterol(1+) (CHEBI:68574) is a ammonium ion (CHEBI:35274)
indole alkaloid cation (CHEBI:60521) is a ammonium ion (CHEBI:35274)
irinotecan(1+) (CHEBI:90895) is a ammonium ion (CHEBI:35274)
isopropylaminium (CHEBI:57492) is a ammonium ion (CHEBI:35274)
ivabradine(1+) (CHEBI:85972) is a ammonium ion (CHEBI:35274)
kanamycin A 3'-phosphate(2+) (CHEBI:57909) is a ammonium ion (CHEBI:35274)
kanamycin B(5+) (CHEBI:58549) is a ammonium ion (CHEBI:35274)
kanamycin C(4+) (CHEBI:72755) is a ammonium ion (CHEBI:35274)
kanamycin D(3+) (CHEBI:72947) is a ammonium ion (CHEBI:35274)
kanamycin X(3+) (CHEBI:72756) is a ammonium ion (CHEBI:35274)
ketotifen(1+) (CHEBI:140417) is a ammonium ion (CHEBI:35274)
laudanine(1+) (CHEBI:76102) is a ammonium ion (CHEBI:35274)
legionaminate(1+) (CHEBI:68668) is a ammonium ion (CHEBI:35274)
levobunolol(1+) (CHEBI:72567) is a ammonium ion (CHEBI:35274)
lomitapide(1+) (CHEBI:72302) is a ammonium ion (CHEBI:35274)
loperamide(1+) (CHEBI:86969) is a ammonium ion (CHEBI:35274)
lorcaserin(1+) (CHEBI:65351) is a ammonium ion (CHEBI:35274)
lupanine(1+) (CHEBI:64261) is a ammonium ion (CHEBI:35274)
LY-310762(1+) (CHEBI:140938) is a ammonium ion (CHEBI:35274)
macrocin(1+) (CHEBI:76820) is a ammonium ion (CHEBI:35274)
memantinium(1+) (CHEBI:64325) is a ammonium ion (CHEBI:35274)
methiothepin(2+) (CHEBI:64204) is a ammonium ion (CHEBI:35274)
methoctramine(4+) (CHEBI:73453) is a ammonium ion (CHEBI:35274)
methylammonium (CHEBI:59338) is a ammonium ion (CHEBI:35274)
methylated primary amine(1+) (CHEBI:131823) is a ammonium ion (CHEBI:35274)
methylphenidate(1+) (CHEBI:51856) is a ammonium ion (CHEBI:35274)
methymycin(1+) (CHEBI:77352) is a ammonium ion (CHEBI:35274)
metoclopramide(1+) (CHEBI:61170) is a ammonium ion (CHEBI:35274)
metoclopramide(2+) (CHEBI:61172) is a ammonium ion (CHEBI:35274)
midodrine(1+) (CHEBI:73243) is a ammonium ion (CHEBI:35274)
morphine(1+) (CHEBI:58097) is a ammonium ion (CHEBI:35274)
morphiniumone(1+) (CHEBI:57728) is a ammonium ion (CHEBI:35274)
moxifloxacinium(1+) (CHEBI:63699) is a ammonium ion (CHEBI:35274)
mycinamicin cation (CHEBI:63309) is a ammonium ion (CHEBI:35274)
naloxone(1+) (CHEBI:90756) is a ammonium ion (CHEBI:35274)
naltrexone(1+) (CHEBI:134688) is a ammonium ion (CHEBI:35274)
NAN 190(1+) (CHEBI:64132) is a ammonium ion (CHEBI:35274)
narbomycin(1+) (CHEBI:76801) is a ammonium ion (CHEBI:35274)
neamine(4+) (CHEBI:65076) is a ammonium ion (CHEBI:35274)
nebramycin 5'(5+) (CHEBI:73679) is a ammonium ion (CHEBI:35274)
nelfinavir(1+) (CHEBI:78767) is a ammonium ion (CHEBI:35274)
neomethymycin(1+) (CHEBI:77353) is a ammonium ion (CHEBI:35274)
neomycin C(6+) (CHEBI:65077) is a ammonium ion (CHEBI:35274)
neopikromycin(1+) (CHEBI:77350) is a ammonium ion (CHEBI:35274)
neopinone(1+) (CHEBI:59950) is a ammonium ion (CHEBI:35274)
norajmaline(1+) (CHEBI:77618) is a ammonium ion (CHEBI:35274)
norbelladine(1+) (CHEBI:134001) is a ammonium ion (CHEBI:35274)
nororientalinium(1+) (CHEBI:57996) is a ammonium ion (CHEBI:35274)
novamethymycin(1+) (CHEBI:77354) is a ammonium ion (CHEBI:35274)
novapikromycin(1+) (CHEBI:77351) is a ammonium ion (CHEBI:35274)
octopaminium (CHEBI:58025) is a ammonium ion (CHEBI:35274)
oleandomycin(1+) (CHEBI:57933) is a ammonium ion (CHEBI:35274)
olodaterol(1+) (CHEBI:83312) is a ammonium ion (CHEBI:35274)
osimertinib(1+) (CHEBI:90949) is a ammonium ion (CHEBI:35274)
oxycodone(1+) (CHEBI:134686) is a ammonium ion (CHEBI:35274)
palonosetron(1+) (CHEBI:85163) is a ammonium ion (CHEBI:35274)
panobinostat(1+) (CHEBI:85992) is a ammonium ion (CHEBI:35274)
paromamine(3+) (CHEBI:65015) is a ammonium ion (CHEBI:35274)
paroxetinium(1+) (CHEBI:64197) is a ammonium ion (CHEBI:35274)
pavine(1+) (CHEBI:76921) is a ammonium ion (CHEBI:35274)
PD-153035(1+) (CHEBI:91077) is a ammonium ion (CHEBI:35274)
pergolide(1+) (CHEBI:63706) is a ammonium ion (CHEBI:35274)
PF-670462 free base(2+) (CHEBI:87284) is a ammonium ion (CHEBI:35274)
phenazopyridine(1+) (CHEBI:71420) is a ammonium ion (CHEBI:35274)
phenylephrine(1+) (CHEBI:132294) is a ammonium ion (CHEBI:35274)
phenylethanolaminium (CHEBI:57741) is a ammonium ion (CHEBI:35274)
pikromycin(1+) (CHEBI:76800) is a ammonium ion (CHEBI:35274)
pipamperone(2+) (CHEBI:78943) is a ammonium ion (CHEBI:35274)
piperidinium ion (CHEBI:48633) is a ammonium ion (CHEBI:35274)
pizotifen(1+) (CHEBI:50318) is a ammonium ion (CHEBI:35274)
pramipexole(2+) (CHEBI:63218) is a ammonium ion (CHEBI:35274)
primary ammonium ion (CHEBI:65296) is a ammonium ion (CHEBI:35274)
promethazine(1+) (CHEBI:61214) is a ammonium ion (CHEBI:35274)
propafenone(1+) (CHEBI:63650) is a ammonium ion (CHEBI:35274)
propan-1-aminium (CHEBI:566825) is a ammonium ion (CHEBI:35274)
pseudoephedrine(1+) (CHEBI:132296) is a ammonium ion (CHEBI:35274)
pseudooxynicotinium(1+) (CHEBI:66878) is a ammonium ion (CHEBI:35274)
pseudotropinium (CHEBI:57493) is a ammonium ion (CHEBI:35274)
psychosine(1+) (CHEBI:57934) is a ammonium ion (CHEBI:35274)
pyridoxaminium(1+) (CHEBI:57761) is a ammonium ion (CHEBI:35274)
quaternary ammonium ion (CHEBI:35267) is a ammonium ion (CHEBI:35274)
queuine(1+) (CHEBI:77674) is a ammonium ion (CHEBI:35274)
raloxifene(1+) (CHEBI:90191) is a ammonium ion (CHEBI:35274)
rhodomycin D(1+) (CHEBI:77073) is a ammonium ion (CHEBI:35274)
ribostamycin(4+) (CHEBI:65028) is a ammonium ion (CHEBI:35274)
rivastigmine(1+) (CHEBI:64363) is a ammonium ion (CHEBI:35274)
Ro 48-8071(1+) (CHEBI:101224) is a ammonium ion (CHEBI:35274)
rolapitant(1+) (CHEBI:90913) is a ammonium ion (CHEBI:35274)
RS 39604(1+) (CHEBI:64082) is a ammonium ion (CHEBI:35274)
rucaparib(1+) (CHEBI:134695) is a ammonium ion (CHEBI:35274)
salutaridinium(1+) (CHEBI:58061) is a ammonium ion (CHEBI:35274)
SB 224289(1+) (CHEBI:64071) is a ammonium ion (CHEBI:35274)
scopolamine(1+) (CHEBI:61269) is a ammonium ion (CHEBI:35274)
secondary ammonium ion (CHEBI:137419) is a ammonium ion (CHEBI:35274)
senecionine(1+) (CHEBI:77617) is a ammonium ion (CHEBI:35274)
serotonin(1+) (CHEBI:350546) is a ammonium ion (CHEBI:35274)
sertraline(1+) (CHEBI:64214) is a ammonium ion (CHEBI:35274)
SIS3 free base(1+) (CHEBI:87591) is a ammonium ion (CHEBI:35274)
sotalol(1+) (CHEBI:63647) is a ammonium ion (CHEBI:35274)
spectinomycin(2+) (CHEBI:77315) is a ammonium ion (CHEBI:35274)
spermidine(3+) (CHEBI:57834) is a ammonium ion (CHEBI:35274)
spermine(4+) (CHEBI:45725) is a ammonium ion (CHEBI:35274)
sphingosine-1-phosphocholine(1+) (CHEBI:58906) is a ammonium ion (CHEBI:35274)
staurosporinium (CHEBI:57491) is a ammonium ion (CHEBI:35274)
strictosidine aglycone(1+) (CHEBI:58012) is a ammonium ion (CHEBI:35274)
sumatriptan(1+) (CHEBI:64364) is a ammonium ion (CHEBI:35274)
synephrinium (CHEBI:58606) is a ammonium ion (CHEBI:35274)
tenofovir alafenamide(1+) (CHEBI:90927) is a ammonium ion (CHEBI:35274)
terbinafine(1+) (CHEBI:77615) is a ammonium ion (CHEBI:35274)
tetradecaphytosphingosine(1+) (CHEBI:82879) is a ammonium ion (CHEBI:35274)
thebaine(1+) (CHEBI:59953) is a ammonium ion (CHEBI:35274)
thermosperminium(4+) (CHEBI:59903) is a ammonium ion (CHEBI:35274)
thiocyclam(1+) (CHEBI:133552) is a ammonium ion (CHEBI:35274)
tiagabine(1+) (CHEBI:85387) is a ammonium ion (CHEBI:35274)
tobramycin(5+) (CHEBI:73678) is a ammonium ion (CHEBI:35274)
tricaine(1+) (CHEBI:131337) is a ammonium ion (CHEBI:35274)
triethanolammonium (CHEBI:132755) is a ammonium ion (CHEBI:35274)
triethylammonium ion (CHEBI:45791) is a ammonium ion (CHEBI:35274)
trimethylammonium (CHEBI:58389) is a ammonium ion (CHEBI:35274)
triprolidine(1+) (CHEBI:84117) is a ammonium ion (CHEBI:35274)
tropinium (CHEBI:57554) is a ammonium ion (CHEBI:35274)
tropiniumone (CHEBI:57851) is a ammonium ion (CHEBI:35274)
tropisetron(1+) (CHEBI:77571) is a ammonium ion (CHEBI:35274)
trovafloxacin(1+) (CHEBI:77569) is a ammonium ion (CHEBI:35274)
trypanothione disulfide(1+) (CHEBI:58661) is a ammonium ion (CHEBI:35274)
tryptaminium (CHEBI:57887) is a ammonium ion (CHEBI:35274)
tylosin(1+) (CHEBI:77047) is a ammonium ion (CHEBI:35274)
tyraminium (CHEBI:327995) is a ammonium ion (CHEBI:35274)
validamycin A(1+) (CHEBI:90869) is a ammonium ion (CHEBI:35274)
validoxylamine A(1+) (CHEBI:111505) is a ammonium ion (CHEBI:35274)
validoxylamine B(1+) (CHEBI:141055) is a ammonium ion (CHEBI:35274)
vanoxerine(2+) (CHEBI:64087) is a ammonium ion (CHEBI:35274)
varenicline(1+) (CHEBI:84508) is a ammonium ion (CHEBI:35274)
vilanterol(1+) (CHEBI:75039) is a ammonium ion (CHEBI:35274)
vinca alkaloid cation (CHEBI:60082) is a ammonium ion (CHEBI:35274)
vortioxetine(1+) (CHEBI:76017) is a ammonium ion (CHEBI:35274)
ZM 323881(1+) (CHEBI:91187) is a ammonium ion (CHEBI:35274)
Synonyms Sources
ammonium ions ChEBI
azanium ions ChEBI
Last Modified
05 June 2018