EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N2O3 |
| Net Charge | 0 |
| Average Mass | 226.276 |
| Monoisotopic Mass | 226.13174 |
| SMILES | CCCC(C)C1(CC)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C11H18N2O3/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16) |
| InChIKey | WEXRUCMBJFQVBZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentobarbital (CHEBI:7983) has role GABAA receptor agonist (CHEBI:91016) |
| pentobarbital (CHEBI:7983) is a barbiturates (CHEBI:22693) |
| IUPAC Name |
|---|
| 5-ethyl-5-(pentan-2-yl)pyrimidine-2,4,6(1H,3H,5H)-trione |
| Synonyms | Source |
|---|---|
| Pentobarbital | KEGG COMPOUND |
| 5-ethyl-5-(sec-pentyl)barbituric acid | NIST Chemistry WebBook |
| 5-ethyl-5-(1-methylbutyl)barbituric acid | NIST Chemistry WebBook |
| Nembutal | NIST Chemistry WebBook |
| 5-Ethyl-5-(1-methylbutyl)-2,4,6(1H,3H,5H)-pyrimidinetrione | KEGG COMPOUND |
| 5-Ethyl-5-(1-methyl-butyl)-pyrimidine-2,4,6-trione | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C07422 | KEGG COMPOUND |
| Pentobarbital | Wikipedia |
| DB00312 | DrugBank |
| D00499 | KEGG DRUG |
| HMDB0014457 | HMDB |
| LSM-1566 | LINCS |
| 2095 | DrugCentral |
| 3000 | VSDB |
| Citations |
|---|