EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31NO5 |
| Net Charge | 0 |
| Average Mass | 461.558 |
| Monoisotopic Mass | 461.22022 |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(O)CNC(C)(C)C)cc2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H31NO5/c1-18-6-10-20(11-7-18)26(31)33-24-15-14-22(23(30)17-29-28(3,4)5)16-25(24)34-27(32)21-12-8-19(2)9-13-21/h6-16,23,29-30H,17H2,1-5H3 |
| InChIKey | FZGVEKPRDOIXJY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. anti-asthmatic drug A drug used to treat asthma. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bitolterol (CHEBI:3133) has role anti-asthmatic drug (CHEBI:49167) |
| bitolterol (CHEBI:3133) has role bronchodilator agent (CHEBI:35523) |
| bitolterol (CHEBI:3133) has role prodrug (CHEBI:50266) |
| bitolterol (CHEBI:3133) has role β-adrenergic agonist (CHEBI:35522) |
| bitolterol (CHEBI:3133) is a carboxylic ester (CHEBI:33308) |
| bitolterol (CHEBI:3133) is a diester (CHEBI:51307) |
| bitolterol (CHEBI:3133) is a ethanolamines (CHEBI:23981) |
| bitolterol (CHEBI:3133) is a secondary alcohol (CHEBI:35681) |
| bitolterol (CHEBI:3133) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| bitolterol mesylate (CHEBI:3134) has part bitolterol (CHEBI:3133) |
| (R)-bitolterol (CHEBI:59188) is a bitolterol (CHEBI:3133) |
| (S)-bitolterol (CHEBI:59189) is a bitolterol (CHEBI:3133) |
| IUPAC Name |
|---|
| 4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diyl bis(4-methylbenzoate) |
| INNs | Source |
|---|---|
| bitolterol | ChemIDplus |
| bitolterolum | ChemIDplus |
| bitolterol | WHO MedNet |
| bitoltérol | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-(2-(tert-butylamino)-1-hydroxyethyl)-o-phenylene di-p-toluate | ChemIDplus |
| bis(4-methylbenzoic acid) 4-[2-(tert-butylamino)-1-hydroxyethyl]-1,2-phenylene ester | ChEBI |
| 4-[2-(tert-butylamino)-1-hydroxyethyl]-o-phenylene di-p-toluate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2229527 | Reaxys |
| CAS:30392-40-6 | KEGG COMPOUND |
| CAS:30392-40-6 | ChemIDplus |
| Citations |
|---|