Mrv0541 06231415172D 26 28 0 0 0 0 999 V2000 -1.3019 -29.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5825 -29.6843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1269 -29.2631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1169 -28.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6025 -28.0344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3119 -28.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5706 -26.0364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7470 -26.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9861 -25.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6930 -27.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2641 -27.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3391 -25.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5781 -24.6050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6930 -27.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2641 -27.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7546 -24.6021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9786 -28.4011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.3438 -23.8802 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 2.9850 -29.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2751 -29.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5557 -29.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8463 -29.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8563 -30.4919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0313 -28.0518 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 2.9785 -26.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4003 -26.0367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 2 0 0 0 0 3 22 1 0 0 0 0 4 3 1 0 0 0 0 5 4 2 0 0 0 0 6 5 1 0 0 0 0 6 1 2 0 0 0 0 24 6 1 0 0 0 0 25 7 1 0 0 0 0 8 7 1 0 0 0 0 9 7 2 0 0 0 0 12 8 2 0 0 0 0 13 9 1 0 0 0 0 10 25 1 0 0 0 0 14 10 1 0 0 0 0 11 25 1 0 0 0 0 15 11 1 0 0 0 0 16 12 1 0 0 0 0 16 13 2 0 0 0 0 17 14 1 0 0 0 0 17 15 1 0 0 0 0 18 16 1 0 0 0 0 19 17 1 0 0 0 0 20 19 1 0 0 0 0 21 20 1 0 0 0 0 22 21 1 0 0 0 0 23 22 2 0 0 0 0 25 26 1 0 0 0 0 M END > CHEBI:5613 > haloperidol > A compound composed of a central piperidine structure with hydroxy and p-chlorophenyl substituents at position 4 and an N-linked p-fluorobutyrophenone moiety. > 3 > gamma-(4-(p-chlorophenyl)-4-hydroxpiperidino)-p-fluorbutyrophenone; 4-[4-(4-chlorophenyl)-4-hydroxy-1-piperidyl]-1-(4-fluorophenyl)-butan-1-one; 4-(4-(para-chlorophenyl)-4-hydroxypiperidino)-4'-fluorobutyrophenone; 4'-fluoro-4-(4-hydroxy-4-(4'-chlorophenyl)piperidino)butyrophenone; 4'-fluoro-4-(4-(p-chlorophenyl)-4-hydroxypiperidinyl)butyrophenone; 1-(3-p-fluorobenzoylpropyl)-4-p-chlorophenyl-4-hydroxypiperidine > 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one > haloperidolum; haloperidol > Haldol > C21H23ClFNO2 > 375.86400 > 375.14013 > 0 > OC1(CCN(CCCC(=O)c2ccc(F)cc2)CC1)c1ccc(Cl)cc1 > InChI=1S/C21H23ClFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-10,26H,1-2,11-15H2 > LNEPOXFFQSENCJ-UHFFFAOYSA-N > 331267 > 52-86-8 > 331267 > 52-86-8 > DB00502 > C01814 > D00136 > LSM-3512 > 52-86-8 > Haloperidol > 10628896; 11304647; 25007358; 6725621; 7602118 $$$$