Ketcher 03082410552D 1 1.00000 0.00000 0 16 16 0 1 0 999 V2000 12.3221 -13.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1880 -14.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4561 -14.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5900 -15.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7241 -15.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7241 -14.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5900 -13.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4561 -15.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1880 -15.4532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.0541 -13.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9201 -14.4531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.0541 -12.9532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8580 -15.9531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9920 -15.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5900 -16.9532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7239 -17.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 2 10 1 0 0 0 3 1 1 0 0 0 5 4 1 0 0 0 6 5 2 0 0 0 7 6 1 0 0 0 3 7 2 0 0 0 3 8 1 0 0 0 4 8 2 0 0 0 2 9 1 1 0 0 11 10 1 0 0 0 12 10 2 0 0 0 5 13 1 0 0 0 13 14 1 0 0 0 4 15 1 0 0 0 15 16 1 0 0 0 M END > CHEBI:229731 > 3,4-dimethoxy-L-phenylalanine > A L-tyrosine derivative that is L-dopa in which the hydroxy groups at positions 3 and 4 of the phenyl ring are replaced by methoxy groups. > 3 > L-veratrylglycine; DMPA; beta-(3,4-dimethoxyphenyl)-L-alanine; 3-(3,4-dimethoxyphenyl)-L-alanine; (S)-3,4-dimethoxyphenylalanine; (S)-2-amino-3-(3,4-dimethoxyphenyl)propanoic acid; (2S)-2-amino-3-(3,4-dimethoxyphenyl)propanoic acid > 3-methoxy-O-methyl-L-tyrosine > C11H15NO4 > 225.244 > 225.10011 > 0 > COC1=CC=C(C[C@H](N)C(O)=O)C=C1OC > InChI=1S/C11H15NO4/c1-15-9-4-3-7(6-10(9)16-2)5-8(12)11(13)14/h3-4,6,8H,5,12H2,1-2H3,(H,13,14)/t8-/m0/s1 > VWTFNYVAFGYEKI-QMMMGPOBSA-N > 32161-30-1 > 34882925; 36662259; 38415939 $$$$