Marvin 03021115072D 15 14 0 0 1 0 999 V2000 12.5286 -2.0568 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 11.8142 -2.4694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0997 -2.0570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8142 -3.2944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0998 -3.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0998 -4.5320 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 11.8144 -4.9444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8144 -5.7694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5288 -4.5319 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 10.3854 -4.9445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.6709 -4.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6708 -3.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9564 -4.9446 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2419 -4.5323 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0 8.9565 -5.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 2 0 0 0 0 7 9 1 0 0 0 0 6 10 1 1 0 0 0 10 11 1 0 0 0 0 11 12 2 0 0 0 0 11 13 1 0 0 0 0 13 14 1 6 0 0 0 15 13 1 0 0 0 0 M CHG 3 1 -1 9 -1 14 1 M END > CHEBI:61396 > L-alanyl-L-glutamate(1-) > A peptide anion that is the conjugate base of L-alanyl-L-glutamic acid, arising from deprotonation of the the two carboxy groups and protonation of the amino group; major species at pH 7.3. > 3 > L-alanyl-L-glutamate anion; L-alanyl-L-glutamate; L-alanine-L-glutamate; L-Ala-L-Glu(1-); (2S)-2-{[(2S)-2-ammoniopropanoyl]amino}pentanedioate > (2S)-2-{[(2S)-2-azaniumylpropanoyl]amino}pentanedioate > C8H13N2O5 > 217.19920 > 217.08300 > -1 > C[C@H]([NH3+])C(=O)N[C@@H](CCC([O-])=O)C([O-])=O > InChI=1S/C8H14N2O5/c1-4(9)7(13)10-5(8(14)15)2-3-6(11)12/h4-5H,2-3,9H2,1H3,(H,10,13)(H,11,12)(H,14,15)/p-1/t4-,5-/m0/s1 > VYZAGTDAHUIRQA-WHFBIAKZSA-M > CPD0-1445 $$$$