Marvin 11051013332D 22 23 0 0 0 0 999 V2000 4.9351 -4.5838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2276 -4.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9351 -5.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2276 -5.8006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5202 -4.5838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5202 -5.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0292 -4.1593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.6426 -4.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3500 -4.5838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1798 -4.5838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5664 -5.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4441 -4.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8127 -4.1593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2276 -6.6213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8590 -4.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1798 -5.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5664 -4.5838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8590 -5.8006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6426 -3.3387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3022 -5.8006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7649 -4.5838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7649 -5.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 2 0 0 0 0 3 1 1 0 0 0 0 8 1 1 0 0 0 0 5 2 1 0 0 0 0 4 3 2 0 0 0 0 6 4 1 0 0 0 0 14 4 1 0 0 0 0 13 5 1 0 0 0 0 6 5 2 0 0 0 0 9 7 1 0 0 0 0 21 7 1 0 0 0 0 9 8 1 0 0 0 0 19 8 1 0 0 0 0 12 10 1 0 0 0 0 15 10 1 0 0 0 0 16 10 2 0 0 0 0 18 11 2 0 0 0 0 20 11 1 0 0 0 0 17 11 1 0 0 0 0 21 12 1 0 0 0 0 17 15 2 0 0 0 0 18 16 1 0 0 0 0 22 21 1 0 0 0 0 M END > CHEBI:149226 > fenoterol > A member of the class resorcinols that is 5-(1-hydroxyethyl)benzene-1,3-diol in which one of the methyl hydrogens is replaced by a 1-(4-hydroxyphenyl)propan-2-amino group. A ?2-adrenergic agonist, it is used (as the hydrobromide salt) as a bronchodilator in the management of reversible airway obstruction. > 3 > phenoterol; 5-{1-Hydroxy-2-[2-(4-hydroxy-phenyl)-1-methyl-ethylamino]-ethyl}-benzene-1,3-diol; 3,5-dihydroxy-alpha-(((p-hydroxy-alpha-methylphenethyl)amino)methyl)benzyl alcohol; 1-(p-hydroxyphenyl)-2-((beta-hydroxy-beta-(3',5'-dihydroxyphenyl))ethyl)aminopropane; 1-(3,5-dihydroxyphenyl)-1-hydroxy-2-((4-hydroxyphenyl)isopropylamino)ethane > 5-(1-hydroxy-2-{[1-(4-hydroxyphenyl)propan-2-yl]amino}ethyl)benzene-1,3-diol > fenoterolum; fenoterol > C17H21NO4 > 303.35290 > 303.14706 > 0 > CC(Cc1ccc(O)cc1)NCC(O)c1cc(O)cc(O)c1 > InChI=1S/C17H21NO4/c1-11(6-12-2-4-14(19)5-3-12)18-10-17(22)13-7-15(20)9-16(21)8-13/h2-5,7-9,11,17-22H,6,10H2,1H3 > LSLYOANBFKQKPT-UHFFFAOYSA-N > 13392-18-2 > 2157041 > 13392-18-2 > DB01288 > D04157 > LSM-1948 > Fenoterol > 17506540; 17845020; 19890360 $$$$